(S)-2-acetamido-N-((S)-1-((S)-1-amino-1-oxopropan-2-ylamino)-1-oxo-3-phenylpropan-2-yl)-3-methylbutanamide

ID: ALA4521299

Cas Number: 132766-05-3

PubChem CID: 101137780

Max Phase: Preclinical

Molecular Formula: C19H28N4O4

Molecular Weight: 376.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(N)=O)C(C)C

Standard InChI:  InChI=1S/C19H28N4O4/c1-11(2)16(22-13(4)24)19(27)23-15(10-14-8-6-5-7-9-14)18(26)21-12(3)17(20)25/h5-9,11-12,15-16H,10H2,1-4H3,(H2,20,25)(H,21,26)(H,22,24)(H,23,27)/t12-,15-,16-/m0/s1

Standard InChI Key:  DYCFRTOMVFZVII-RCBQFDQVSA-N

Molfile:  

 
     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
   12.2852  -20.3191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9905  -19.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6999  -21.1363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6999  -20.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9905  -19.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6999  -18.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2852  -18.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4052  -19.9105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1146  -20.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8240  -19.0933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8240  -19.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1146  -21.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8240  -22.3627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8240  -21.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5298  -21.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2398  -21.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2398  -22.3627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5298  -22.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5293  -20.3191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2387  -19.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9440  -21.1363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2387  -19.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9440  -20.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6534  -19.9105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5758  -19.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8664  -20.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5758  -19.0933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  8  1  0
 11 19  1  0
 23 24  1  0
  1  2  1  0
  2  4  1  0
  4  3  2  0
  2  5  1  1
  5  6  1  0
  5  7  1  0
  8  9  1  0
  9 11  1  0
 11 10  2  0
  9 12  1  6
 12 14  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 19 20  1  0
 20 23  1  0
 23 21  2  0
 20 22  1  1
  1 25  1  0
 25 26  1  0
 25 27  2  0
M  END

Alternative Forms

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 376.46Molecular Weight (Monoisotopic): 376.2111AlogP: -0.14#Rotatable Bonds: 9
Polar Surface Area: 130.39Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.18CX Basic pKa: CX LogP: -0.10CX LogD: -0.10
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.48Np Likeness Score: -0.26

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source