The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(((6-((4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)amino)methyl)phenyl)propionamide ID: ALA4521305
PubChem CID: 155542339
Max Phase: Preclinical
Molecular Formula: C25H31N7O
Molecular Weight: 445.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1ccc(CNc2cc(Nc3ccc(N4CCN(C)CC4)cc3)ncn2)cc1
Standard InChI: InChI=1S/C25H31N7O/c1-3-25(33)30-21-6-4-19(5-7-21)17-26-23-16-24(28-18-27-23)29-20-8-10-22(11-9-20)32-14-12-31(2)13-15-32/h4-11,16,18H,3,12-15,17H2,1-2H3,(H,30,33)(H2,26,27,28,29)
Standard InChI Key: AUOYLMSFGJRSFJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
23.3793 -17.5242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3782 -18.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0862 -18.7527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7959 -18.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7931 -17.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0844 -17.1153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0820 -16.2981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5042 -18.7507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7885 -15.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7861 -15.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4944 -14.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4923 -13.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7828 -13.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0740 -13.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0796 -14.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2113 -18.3410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9163 -18.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6229 -18.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6221 -17.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9087 -17.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2051 -17.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3231 -17.1124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0318 -17.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7362 -17.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7381 -16.2964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0293 -15.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3188 -16.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4462 -15.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7793 -12.6231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4852 -12.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4817 -11.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1947 -12.6170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1877 -10.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
4 8 1 0
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
19 22 1 0
25 28 1 0
13 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.57Molecular Weight (Monoisotopic): 445.2590AlogP: 3.93#Rotatable Bonds: 8Polar Surface Area: 85.42Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.10CX LogP: 3.77CX LogD: 3.04Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -1.51
References 1. Yu RN, Chen CJ, Shu L, Yin Y, Wang ZJ, Zhang TT, Zhang DY.. (2019) Structure-based design and synthesis of pyrimidine-4,6-diamine derivatives as Janus kinase 3 inhibitors., 27 (8): [PMID:30853331 ] [10.1016/j.bmc.2019.03.009 ]