The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-bromophenyl)-N-(butylsulfamoyl)-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine ID: ALA4521348
PubChem CID: 21041283
Max Phase: Preclinical
Molecular Formula: C21H25BrN6O5S
Molecular Weight: 553.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(OC)cn2)c1-c1ccc(Br)cc1
Standard InChI: InChI=1S/C21H25BrN6O5S/c1-3-4-9-27-34(29,30)28-19-18(15-5-7-16(22)8-6-15)20(26-14-25-19)32-10-11-33-21-23-12-17(31-2)13-24-21/h5-8,12-14,27H,3-4,9-11H2,1-2H3,(H,25,26,28)
Standard InChI Key: ZWTAXWXITAZUQP-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
4.6885 -12.2909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1013 -13.0008 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5097 -12.2884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1081 -14.6351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1069 -15.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8150 -15.8636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5247 -15.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5218 -14.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8132 -14.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8108 -13.4091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3954 -13.4133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2330 -15.8617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2343 -16.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9426 -17.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9439 -17.9035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6523 -18.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6492 -19.1267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3567 -19.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0648 -19.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0608 -18.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3528 -17.8992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2280 -14.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9345 -14.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6402 -14.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6375 -13.4005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9233 -12.9948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2206 -13.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3432 -12.9883 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
10.7736 -19.5308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7760 -20.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6855 -13.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9800 -13.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2701 -13.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5646 -13.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 2 1 0
2 11 1 0
7 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
19 29 1 0
29 30 1 0
11 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.44Molecular Weight (Monoisotopic): 552.0791AlogP: 3.21#Rotatable Bonds: 13Polar Surface Area: 137.45Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.76CX Basic pKa: 3.26CX LogP: 3.20CX LogD: 3.07Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.10
References 1. Boss C, Bolli MH, Gatfield J.. (2016) From bosentan (Tracleer®) to macitentan (Opsumit®): The medicinal chemistry perspective., 26 (15): [PMID:27321813 ] [10.1016/j.bmcl.2016.06.014 ]