The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Fluoro-4-(1-(1-(5-fluoroquinolin-6-yl)propyl)-1H-imidazo[4,5-b]pyrazin-6-yl)-N-methylbenzamide ID: ALA4521417
PubChem CID: 155542724
Max Phase: Preclinical
Molecular Formula: C25H20F2N6O
Molecular Weight: 458.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(c1ccc2ncccc2c1F)n1cnc2ncc(-c3ccc(C(=O)NC)c(F)c3)nc21
Standard InChI: InChI=1S/C25H20F2N6O/c1-3-21(17-8-9-19-16(22(17)27)5-4-10-29-19)33-13-31-23-24(33)32-20(12-30-23)14-6-7-15(18(26)11-14)25(34)28-2/h4-13,21H,3H2,1-2H3,(H,28,34)
Standard InChI Key: OZVMVFNGBIZIAF-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
28.5879 -1.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5868 -2.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2948 -2.6193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2930 -0.9820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0016 -1.3872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0064 -2.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7865 -2.4543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2638 -1.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7787 -1.1298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0435 -3.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5002 -3.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8438 -3.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0956 -4.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8951 -4.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3795 -2.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1784 -2.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4362 -3.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2384 -3.8911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7836 -3.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5210 -2.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7194 -2.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7573 -4.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8806 -2.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1729 -2.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4654 -2.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4643 -3.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1767 -3.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8813 -3.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7568 -3.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0489 -3.4340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7573 -4.6594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0485 -2.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1789 -4.6594 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.1184 -2.0107 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
7 10 1 0
10 11 1 0
10 12 1 0
12 13 2 0
13 14 1 0
14 17 2 0
16 15 2 0
15 12 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
11 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
2 23 1 0
26 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
27 33 1 0
15 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.47Molecular Weight (Monoisotopic): 458.1667AlogP: 4.68#Rotatable Bonds: 5Polar Surface Area: 85.59Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.81CX Basic pKa: 4.20CX LogP: 3.95CX LogD: 3.95Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -1.41
References 1. Zhao F, Zhang J, Zhang L, Hao Y, Shi C, Xia G, Yu J, Liu Y.. (2016) Discovery and optimization of a series of imidazo[4,5-b]pyrazine derivatives as highly potent and exquisitely selective inhibitors of the mesenchymal-epithelial transition factor (c-Met) protein kinase., 24 (18): [PMID:27448775 ] [10.1016/j.bmc.2016.07.019 ]