The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 4-(4-Fluorophenyl)-4-methyl-2-(6-methylpyridazin-3-yl)-6-(morpholinomethyl)-1H-pyrimidine-5-carboxylate ID: ALA4521446
PubChem CID: 155542769
Max Phase: Preclinical
Molecular Formula: C23H26FN5O3
Molecular Weight: 439.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(CN2CCOCC2)NC(c2ccc(C)nn2)=NC1(C)c1ccc(F)cc1
Standard InChI: InChI=1S/C23H26FN5O3/c1-15-4-9-18(28-27-15)21-25-19(14-29-10-12-32-13-11-29)20(22(30)31-3)23(2,26-21)16-5-7-17(24)8-6-16/h4-9H,10-14H2,1-3H3,(H,25,26)
Standard InChI Key: WGHFFXBDRCEPQT-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
13.6874 -12.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9880 -12.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0035 -11.3604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2975 -10.9424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5810 -11.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5741 -12.1598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2715 -12.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8790 -10.9256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1660 -11.3244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4652 -10.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4798 -10.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1912 -9.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8931 -10.1066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6791 -9.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7246 -9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4558 -8.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9932 -7.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7991 -7.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0635 -8.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5285 -9.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3324 -7.2238 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.7801 -9.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7902 -8.8495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0651 -10.0639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3661 -9.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7539 -11.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7359 -12.1147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0246 -12.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0084 -13.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7055 -13.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4221 -13.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4361 -12.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
2 7 1 0
5 8 1 0
8 9 1 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 1 0
8 13 2 0
12 14 1 0
12 15 1 0
15 16 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
18 21 1 0
11 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
10 26 1 0
26 27 1 0
27 28 1 0
29 28 1 0
30 29 1 0
31 30 1 0
32 31 1 0
27 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.49Molecular Weight (Monoisotopic): 439.2020AlogP: 1.95#Rotatable Bonds: 5Polar Surface Area: 88.94Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.98CX LogP: 1.38CX LogD: 1.38Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.71Np Likeness Score: -1.20
References 1. Qiu Z, Lin X, Zhou M, Liu Y, Zhu W, Chen W, Zhang W, Guo L, Liu H, Wu G, Huang M, Jiang M, Xu Z, Zhou Z, Qin N, Ren S, Qiu H, Zhong S, Zhang Y, Zhang Y, Wu X, Shi L, Shen F, Mao Y, Zhou X, Yang W, Wu JZ, Yang G, Mayweg AV, Shen HC, Tang G.. (2016) Design and Synthesis of Orally Bioavailable 4-Methyl Heteroaryldihydropyrimidine Based Hepatitis B Virus (HBV) Capsid Inhibitors., 59 (16): [PMID:27458651 ] [10.1021/acs.jmedchem.6b00879 ]