Methyl 4-(4-Fluorophenyl)-4-methyl-2-(6-methylpyridazin-3-yl)-6-(morpholinomethyl)-1H-pyrimidine-5-carboxylate

ID: ALA4521446

PubChem CID: 155542769

Max Phase: Preclinical

Molecular Formula: C23H26FN5O3

Molecular Weight: 439.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)C1=C(CN2CCOCC2)NC(c2ccc(C)nn2)=NC1(C)c1ccc(F)cc1

Standard InChI:  InChI=1S/C23H26FN5O3/c1-15-4-9-18(28-27-15)21-25-19(14-29-10-12-32-13-11-29)20(22(30)31-3)23(2,26-21)16-5-7-17(24)8-6-16/h4-9H,10-14H2,1-3H3,(H,25,26)

Standard InChI Key:  WGHFFXBDRCEPQT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   13.6874  -12.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9880  -12.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0035  -11.3604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2975  -10.9424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5810  -11.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5741  -12.1598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2715  -12.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8790  -10.9256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1660  -11.3244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4652  -10.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4798  -10.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1912   -9.6891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8931  -10.1066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6791   -9.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7246   -9.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4558   -8.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9932   -7.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7991   -7.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0635   -8.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5285   -9.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3324   -7.2238    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7801   -9.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7902   -8.8495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0651  -10.0639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3661   -9.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7539  -11.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7359  -12.1147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0246  -12.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0084  -13.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7055  -13.7530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4221  -13.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4361  -12.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  2  7  1  0
  5  8  1  0
  8  9  1  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  1  0
  8 13  2  0
 12 14  1  0
 12 15  1  0
 15 16  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 18 21  1  0
 11 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 10 26  1  0
 26 27  1  0
 27 28  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4521446

    ---

Associated Targets(non-human)

Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.49Molecular Weight (Monoisotopic): 439.2020AlogP: 1.95#Rotatable Bonds: 5
Polar Surface Area: 88.94Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.98CX LogP: 1.38CX LogD: 1.38
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.71Np Likeness Score: -1.20

References

1. Qiu Z, Lin X, Zhou M, Liu Y, Zhu W, Chen W, Zhang W, Guo L, Liu H, Wu G, Huang M, Jiang M, Xu Z, Zhou Z, Qin N, Ren S, Qiu H, Zhong S, Zhang Y, Zhang Y, Wu X, Shi L, Shen F, Mao Y, Zhou X, Yang W, Wu JZ, Yang G, Mayweg AV, Shen HC, Tang G..  (2016)  Design and Synthesis of Orally Bioavailable 4-Methyl Heteroaryldihydropyrimidine Based Hepatitis B Virus (HBV) Capsid Inhibitors.,  59  (16): [PMID:27458651] [10.1021/acs.jmedchem.6b00879]

Source