The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(4-(4-trifluoromethylphenyl)piperazin-1-yl)butyl)-4-(thiophen-3-yl)benzamide ID: ALA4521525
PubChem CID: 155542687
Max Phase: Preclinical
Molecular Formula: C26H28F3N3OS
Molecular Weight: 487.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCCCN1CCN(c2ccc(C(F)(F)F)cc2)CC1)c1ccc(-c2ccsc2)cc1
Standard InChI: InChI=1S/C26H28F3N3OS/c27-26(28,29)23-7-9-24(10-8-23)32-16-14-31(15-17-32)13-2-1-12-30-25(33)21-5-3-20(4-6-21)22-11-18-34-19-22/h3-11,18-19H,1-2,12-17H2,(H,30,33)
Standard InChI Key: BUJDRHDSUWKHNQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
4.4863 -11.3705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4863 -12.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1916 -12.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8969 -12.1877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8969 -11.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1916 -10.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7774 -10.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7787 -10.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0707 -9.7414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3632 -10.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3682 -10.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0769 -11.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6040 -12.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3123 -12.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0194 -12.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7277 -12.1918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4348 -12.6014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1431 -12.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8502 -12.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1443 -11.3767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8465 -13.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5528 -13.8282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2621 -13.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2607 -12.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5538 -12.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9729 -13.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0582 -14.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8575 -14.8094 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.2662 -14.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7194 -13.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6537 -9.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6503 -8.9293 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9478 -10.1581 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9410 -9.3358 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 19 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 30 2 0
30 26 1 0
23 26 1 0
10 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.59Molecular Weight (Monoisotopic): 487.1905AlogP: 5.77#Rotatable Bonds: 8Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.18CX LogP: 5.69CX LogD: 4.84Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -1.90
References 1. Chen PJ, Taylor M, Griffin SA, Amani A, Hayatshahi H, Korzekwa K, Ye M, Mach RH, Liu J, Luedtke RR, Gordon JC, Blass BE.. (2019) Design, synthesis, and evaluation of N-(4-(4-phenyl piperazin-1-yl)butyl)-4-(thiophen-3-yl)benzamides as selective dopamine D3 receptor ligands., 29 (18): [PMID:31387791 ] [10.1016/j.bmcl.2019.07.020 ]