The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R)-2-[[6-ethyl-2-[3-(ethylsulfamoyl)phenyl]-5-[3-(4-fluorophenoxy)phenyl]thieno[2,3-d]pyrimidin-4-yl]amino]propanoic acid ID: ALA4521569
PubChem CID: 155542773
Max Phase: Preclinical
Molecular Formula: C31H29FN4O5S2
Molecular Weight: 620.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNS(=O)(=O)c1cccc(-c2nc(N[C@H](C)C(=O)O)c3c(-c4cccc(Oc5ccc(F)cc5)c4)c(CC)sc3n2)c1
Standard InChI: InChI=1S/C31H29FN4O5S2/c1-4-25-26(19-8-6-10-23(16-19)41-22-14-12-21(32)13-15-22)27-29(34-18(3)31(37)38)35-28(36-30(27)42-25)20-9-7-11-24(17-20)43(39,40)33-5-2/h6-18,33H,4-5H2,1-3H3,(H,37,38)(H,34,35,36)/t18-/m1/s1
Standard InChI Key: FCCICGZGYLPBLZ-GOSISDBHSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
29.7157 -23.3527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9274 -23.5673 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.5074 -24.1427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9272 -22.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2149 -22.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2160 -21.5263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9235 -21.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6312 -21.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3349 -21.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3361 -20.3038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0453 -19.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7540 -20.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7542 -21.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0471 -21.5323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5329 -21.3715 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.0098 -20.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5324 -20.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7806 -19.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5858 -19.1033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8340 -18.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2867 -17.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4838 -17.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2352 -18.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6333 -18.1571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1842 -18.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9264 -19.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4724 -20.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2727 -19.9773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5241 -19.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9806 -18.5916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8243 -20.5839 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.8270 -20.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2399 -21.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0429 -19.0777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3298 -18.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6234 -19.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9144 -18.6755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6258 -19.8991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3274 -17.8540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6319 -22.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2229 -23.9852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5141 -23.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8116 -23.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
5 4 1 0
6 5 2 0
7 6 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
12 13 1 0
14 13 2 0
9 14 1 0
13 15 1 0
15 16 1 0
16 17 2 0
17 12 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
20 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
16 32 1 0
32 33 1 0
11 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 2 0
35 39 1 1
40 8 1 0
4 40 2 0
2 41 1 0
41 42 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 620.73Molecular Weight (Monoisotopic): 620.1563AlogP: 6.70#Rotatable Bonds: 11Polar Surface Area: 130.51Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.47CX Basic pKa: 3.65CX LogP: 6.89CX LogD: 4.37Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.15Np Likeness Score: -1.53
References 1. Szlávik Z, Ondi L, Csékei M, Paczal A, Szabó ZB, Radics G, Murray J, Davidson J, Chen I, Davis B, Hubbard RE, Pedder C, Dokurno P, Surgenor A, Smith J, Robertson A, LeToumelin-Braizat G, Cauquil N, Zarka M, Demarles D, Perron-Sierra F, Claperon A, Colland F, Geneste O, Kotschy A.. (2019) Structure-Guided Discovery of a Selective Mcl-1 Inhibitor with Cellular Activity., 62 (15): [PMID:31339316 ] [10.1021/acs.jmedchem.9b00134 ]