Penicilone G

ID: ALA4521660

PubChem CID: 145720776

Max Phase: Preclinical

Molecular Formula: C29H35BrO7

Molecular Weight: 575.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCC[C@H](C)/C=C(\C)C(=O)O[C@]1(C)C(=O)C2=COC(C3=C(C)C[C@@H](O)CC3=O)=CC2=C(Br)C1=O

Standard InChI:  InChI=1S/C29H35BrO7/c1-6-7-8-9-10-16(2)11-18(4)28(35)37-29(5)26(33)21-15-36-23(14-20(21)25(30)27(29)34)24-17(3)12-19(31)13-22(24)32/h11,14-16,19,31H,6-10,12-13H2,1-5H3/b18-11+/t16-,19+,29+/m0/s1

Standard InChI Key:  VJHUSRCFHWWYCT-LWGLPVJESA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   23.3766   -8.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3766   -9.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0860  -10.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0860   -8.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7954   -8.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7920   -9.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4982  -10.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2123   -9.6348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2158   -8.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5051   -8.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9302   -8.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6397   -8.8281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3474   -8.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3559   -7.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6506   -7.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9325   -7.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2233   -7.1764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6335   -9.6494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0714   -7.1988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6677   -8.3969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6695  -10.0384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0869  -10.8546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9571   -9.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2458  -10.0405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9559   -8.8096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5334   -9.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8222  -10.0426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2470  -10.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1097   -9.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8234  -10.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3985  -10.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6861   -9.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9790  -10.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2665   -9.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5553  -10.0487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3725  -10.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0860   -7.5693    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  2  0
  5  6  1  0
  5 10  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 11 12  1  0
 11 16  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  9 11  1  0
 16 17  1  0
 12 18  2  0
 14 19  1  1
  1 20  2  0
  2 21  1  0
  3 22  2  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  2  0
 26 27  1  0
 24 28  1  0
 27 29  1  0
 27 30  1  1
 29 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
  2 36  1  6
  4 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4521660

    ---

Associated Targets(Human)

SMMC-7721 (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Enterococcus faecium (13803 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Enterococcus faecalis (29875 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus aureus (210822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 575.50Molecular Weight (Monoisotopic): 574.1566AlogP: 5.48#Rotatable Bonds: 9
Polar Surface Area: 106.97Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.86CX LogD: 5.86
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.17Np Likeness Score: 2.06

References

1. Chen M, Zheng YY, Chen ZQ, Shen NX, Shen L, Zhang FM, Zhou XJ, Wang CY..  (2019)  NaBr-Induced Production of Brominated Azaphilones and Related Tricyclic Polyketides by the Marine-Derived Fungus Penicillium janthinellum HK1-6.,  82  (2): [PMID:30693772] [10.1021/acs.jnatprod.8b00930]

Source