The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(4-((1-(2-(4-chlorophenyl)-2-oxoethyl)-1H-1,2,3-triazol-4-yl)methoxy)benzylidene)thiazolidine-2,4-dione ID: ALA4521668
PubChem CID: 155542709
Max Phase: Preclinical
Molecular Formula: C21H15ClN4O4S
Molecular Weight: 454.90
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)/C(=C/c2ccc(OCc3cn(CC(=O)c4ccc(Cl)cc4)nn3)cc2)S1
Standard InChI: InChI=1S/C21H15ClN4O4S/c22-15-5-3-14(4-6-15)18(27)11-26-10-16(24-25-26)12-30-17-7-1-13(2-8-17)9-19-20(28)23-21(29)31-19/h1-10H,11-12H2,(H,23,28,29)/b19-9-
Standard InChI Key: LIBPWQBUQQENPS-OCKHKDLRSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
36.1700 -5.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3205 -2.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3164 -3.0339 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.0923 -3.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5761 -2.6316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.0990 -1.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4920 -2.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4909 -3.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1989 -3.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9086 -3.0436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9058 -2.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1971 -1.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6119 -1.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3409 -4.0689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.3555 -1.1923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7829 -3.4521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.0755 -3.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3597 -4.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3713 -3.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5979 -3.1869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1082 -3.8411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5786 -4.5095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3528 -5.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9441 -5.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9442 -4.5094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1282 -5.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7196 -6.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1282 -7.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9496 -7.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3545 -6.6287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7205 -8.0469 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 2 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
13 2 2 0
4 14 2 0
6 15 2 0
8 16 1 0
16 17 1 0
17 19 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
22 1 1 0
1 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 24 1 0
28 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.90Molecular Weight (Monoisotopic): 454.0503AlogP: 3.72#Rotatable Bonds: 7Polar Surface Area: 103.18Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.20CX Basic pKa: ┄CX LogP: 3.38CX LogD: 2.23Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.79
References 1. Elzahhar PA, Alaaeddine R, Ibrahim TM, Nassra R, Ismail A, Chua BSK, Frkic RL, Bruning JB, Wallner N, Knape T, von Knethen A, Labib H, El-Yazbi AF, Belal ASF.. (2019) Shooting three inflammatory targets with a single bullet: Novel multi-targeting anti-inflammatory glitazones., 167 [PMID:30818268 ] [10.1016/j.ejmech.2019.02.034 ]