5-Methyl-6-(1-(6-(pyridin-4-yl)-1H-imidazo[4,5-b]pyrazin-1-yl)ethyl)quinoline

ID: ALA4521693

PubChem CID: 141370343

Max Phase: Preclinical

Molecular Formula: C22H18N6

Molecular Weight: 366.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(C(C)n2cnc3ncc(-c4ccncc4)nc32)ccc2ncccc12

Standard InChI:  InChI=1S/C22H18N6/c1-14-17(5-6-19-18(14)4-3-9-24-19)15(2)28-13-26-21-22(28)27-20(12-25-21)16-7-10-23-11-8-16/h3-13,15H,1-2H3

Standard InChI Key:  JVGKUMHPYPYEAK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   15.1538   -7.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1526   -7.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8607   -8.2695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8589   -6.6322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5675   -7.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5723   -7.8560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3523   -8.1045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8297   -7.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3446   -6.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6094   -8.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0661   -9.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4097   -9.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6615   -9.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4610   -9.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9454   -8.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7443   -8.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0021   -9.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8043   -9.5413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3494   -8.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0869   -8.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2853   -7.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6842   -7.6608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4465   -8.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7388   -7.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0313   -8.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0302   -9.0834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7425   -9.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4472   -9.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 12  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 15 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  2 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4521693

    ---

Associated Targets(Human)

MET Tclin Hepatocyte growth factor receptor (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H1993 (343 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.43Molecular Weight (Monoisotopic): 366.1593AlogP: 4.35#Rotatable Bonds: 3
Polar Surface Area: 69.38Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.03CX LogP: 3.37CX LogD: 3.37
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: -1.05

References

1. Zhao F, Zhang J, Zhang L, Hao Y, Shi C, Xia G, Yu J, Liu Y..  (2016)  Discovery and optimization of a series of imidazo[4,5-b]pyrazine derivatives as highly potent and exquisitely selective inhibitors of the mesenchymal-epithelial transition factor (c-Met) protein kinase.,  24  (18): [PMID:27448775] [10.1016/j.bmc.2016.07.019]

Source