3-(2-((3s,5s,7s)-adamantan-1-ylamino)-1-(N-(4-(benzyloxy)benzyl)acetamido)-2-oxoethyl)-6-chloro-1H-indole-2-carboxylic acid

ID: ALA4521788

PubChem CID: 155542750

Max Phase: Preclinical

Molecular Formula: C37H38ClN3O5

Molecular Weight: 640.18

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N(Cc1ccc(OCc2ccccc2)cc1)C(C(=O)NC12CC3CC(CC(C3)C1)C2)c1c(C(=O)O)[nH]c2cc(Cl)ccc12

Standard InChI:  InChI=1S/C37H38ClN3O5/c1-22(42)41(20-23-7-10-29(11-8-23)46-21-24-5-3-2-4-6-24)34(32-30-12-9-28(38)16-31(30)39-33(32)36(44)45)35(43)40-37-17-25-13-26(18-37)15-27(14-25)19-37/h2-12,16,25-27,34,39H,13-15,17-21H2,1H3,(H,40,43)(H,44,45)

Standard InChI Key:  MWAGCBXSLRYTRA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 46 52  0  0  0  0  0  0  0  0999 V2000
    8.4654  -15.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1067  -14.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2698  -15.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8180  -14.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0226  -15.4194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5658  -14.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2672  -14.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8238  -13.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1021  -13.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5716  -13.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7636  -16.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7598  -17.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4734  -18.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4767  -16.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1908  -16.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1886  -17.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9738  -17.9058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4615  -17.2384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9775  -16.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2347  -15.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0421  -15.6154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6844  -15.1701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2992  -14.8315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0438  -18.0580    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.8769  -15.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3265  -14.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5868  -13.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0373  -13.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2288  -13.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9729  -14.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5242  -14.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6777  -12.8837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8705  -13.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3193  -12.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5769  -11.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0265  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2183  -11.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9634  -12.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5155  -12.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7161  -16.0824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2865  -17.2408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6970  -17.9563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7009  -16.5274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9414  -14.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3911  -13.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7488  -14.2168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
 11 12  2  0
 12 13  1  0
 13 16  2  0
 15 14  2  0
 14 11  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  1  0
 23  2  1  0
 12 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 21 40  2  0
 18 41  1  0
 41 42  1  0
 41 43  2  0
 22 44  1  0
 44 45  1  0
 44 46  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4521788

    ---

Associated Targets(Human)

MDM2 Tchem p53-binding protein Mdm-2 (4545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDM4 Tchem Protein Mdm4 (729 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 640.18Molecular Weight (Monoisotopic): 639.2500AlogP: 7.27#Rotatable Bonds: 10
Polar Surface Area: 111.73Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.56CX Basic pKa: CX LogP: 5.91CX LogD: 2.55
Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.17Np Likeness Score: -0.88

References

1. Neochoritis CG, Atmaj J, Twarda-Clapa A, Surmiak E, Skalniak L, Köhler LM, Muszak D, Kurpiewska K, Kalinowska-Tłuścik J, Beck B, Holak TA, Dömling A..  (2019)  Hitting on the move: Targeting intrinsically disordered protein states of the MDM2-p53 interaction.,  182  [PMID:31421630] [10.1016/j.ejmech.2019.111588]

Source