The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-(((S,E)-4-Cyano-1-((S)-2-oxopiperidin-3-yl)-4-(pyridin-2-yl)but-3-en-2-yl)amino)-3-(4-fluorophenyl)-1-oxopropan-2-yl)-5-methylisoxazole-3-carboxamide ID: ALA4521890
PubChem CID: 155542900
Max Phase: Preclinical
Molecular Formula: C29H29FN6O4
Molecular Weight: 544.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C(=O)N[C@@H](Cc2ccc(F)cc2)C(=O)N[C@H](/C=C(/C#N)c2ccccn2)C[C@@H]2CCCNC2=O)no1
Standard InChI: InChI=1S/C29H29FN6O4/c1-18-13-26(36-40-18)29(39)35-25(14-19-7-9-22(30)10-8-19)28(38)34-23(15-20-5-4-12-33-27(20)37)16-21(17-31)24-6-2-3-11-32-24/h2-3,6-11,13,16,20,23,25H,4-5,12,14-15H2,1H3,(H,33,37)(H,34,38)(H,35,39)/b21-16-/t20-,23-,25-/m0/s1
Standard InChI Key: XBMKSEPYSUSMDT-JEDLVBITSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
32.4939 -14.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2068 -13.6259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7810 -13.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4939 -14.8586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9240 -14.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6370 -13.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3499 -14.0339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9240 -14.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6370 -15.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6324 -16.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3445 -16.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0627 -16.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0599 -15.2717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3431 -14.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7762 -16.5076 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.0671 -13.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7800 -14.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4929 -13.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6937 -12.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8873 -12.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4750 -13.3436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0283 -13.9541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5528 -11.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2093 -14.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0671 -12.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3457 -12.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3485 -11.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6321 -10.7853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9140 -11.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9167 -12.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6335 -12.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0663 -10.7866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6370 -12.7971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4899 -12.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2015 -12.3879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1988 -11.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4821 -11.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7667 -11.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7729 -12.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9237 -14.4503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
5 8 1 6
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
16 7 1 1
16 17 1 0
17 18 2 0
3 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 3 2 0
20 23 1 0
18 24 1 0
16 25 1 0
26 25 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
26 31 1 0
27 32 2 0
6 33 2 0
18 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
24 40 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.59Molecular Weight (Monoisotopic): 544.2234AlogP: 2.87#Rotatable Bonds: 10Polar Surface Area: 150.01Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.42CX Basic pKa: 3.14CX LogP: 2.47CX LogD: 2.47Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -0.93
References 1. Ma Y, Li L, He S, Shang C, Sun Y, Liu N, Meek TD, Wang Y, Shang L.. (2019) Application of Dually Activated Michael Acceptor to the Rational Design of Reversible Covalent Inhibitor for Enterovirus 71 3C Protease., 62 (13): [PMID:31184893 ] [10.1021/acs.jmedchem.9b00387 ]