The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Benzhydryl-3-(furan-2-ylmethyl)-5-hydroxy-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione ID: ALA4521905
PubChem CID: 54736410
Max Phase: Preclinical
Molecular Formula: C25H21N3O4
Molecular Weight: 427.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2c(O)c(=O)ccn2N(C(c2ccccc2)c2ccccc2)CN1Cc1ccco1
Standard InChI: InChI=1S/C25H21N3O4/c29-21-13-14-27-23(24(21)30)25(31)26(16-20-12-7-15-32-20)17-28(27)22(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-15,22,30H,16-17H2
Standard InChI Key: NIHXATAPVOQTKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
22.6998 -9.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6998 -10.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4092 -10.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4092 -9.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1186 -9.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1151 -10.5822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8213 -10.9915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5354 -10.5882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5389 -9.7669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8282 -9.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2488 -9.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8306 -8.5276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9867 -9.3502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4092 -8.5227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8168 -11.8115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1027 -12.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5264 -12.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3967 -11.8030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6831 -12.2111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6781 -13.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3927 -13.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1034 -13.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5155 -13.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2243 -13.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9393 -13.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9412 -12.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2319 -11.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9584 -9.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0404 -10.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8429 -10.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2594 -10.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7116 -9.4378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 2 0
3 6 1 0
5 4 2 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
10 12 2 0
1 13 2 0
4 14 1 0
7 15 1 0
15 16 1 0
15 17 1 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 16 1 0
17 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 17 1 0
11 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.46Molecular Weight (Monoisotopic): 427.1532AlogP: 3.49#Rotatable Bonds: 5Polar Surface Area: 78.92Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.73CX Basic pKa: ┄CX LogP: 3.02CX LogD: 3.02Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -0.47
References 1. Miyagawa M, Akiyama T, Taoda Y, Takaya K, Takahashi-Kageyama C, Tomita K, Yasuo K, Hattori K, Shano S, Yoshida R, Shishido T, Yoshinaga T, Sato A, Kawai M.. (2019) Synthesis and SAR Study of Carbamoyl Pyridone Bicycle Derivatives as Potent Inhibitors of Influenza Cap-dependent Endonuclease., 62 (17): [PMID:31386363 ] [10.1021/acs.jmedchem.9b00861 ]