1-Benzhydryl-3-(furan-2-ylmethyl)-5-hydroxy-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione

ID: ALA4521905

PubChem CID: 54736410

Max Phase: Preclinical

Molecular Formula: C25H21N3O4

Molecular Weight: 427.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2c(O)c(=O)ccn2N(C(c2ccccc2)c2ccccc2)CN1Cc1ccco1

Standard InChI:  InChI=1S/C25H21N3O4/c29-21-13-14-27-23(24(21)30)25(31)26(16-20-12-7-15-32-20)17-28(27)22(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-15,22,30H,16-17H2

Standard InChI Key:  NIHXATAPVOQTKM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   22.6998   -9.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6998  -10.5822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4092  -10.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4092   -9.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1186   -9.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1151  -10.5822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8213  -10.9915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5354  -10.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5389   -9.7669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8282   -9.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2488   -9.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8306   -8.5276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9867   -9.3502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4092   -8.5227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8168  -11.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1027  -12.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5264  -12.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3967  -11.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6831  -12.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6781  -13.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3927  -13.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1034  -13.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5155  -13.0472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2243  -13.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9393  -13.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9412  -12.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2319  -11.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9584   -9.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0404  -10.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8429  -10.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2594  -10.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7116   -9.4378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  2  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 10 12  2  0
  1 13  2  0
  4 14  1  0
  7 15  1  0
 15 16  1  0
 15 17  1  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 17 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 17  1  0
 11 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 28  1  0
M  END

Associated Targets(non-human)

PA Polymerase acidic protein (806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Influenza A virus (11224 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 427.46Molecular Weight (Monoisotopic): 427.1532AlogP: 3.49#Rotatable Bonds: 5
Polar Surface Area: 78.92Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.73CX Basic pKa: CX LogP: 3.02CX LogD: 3.02
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -0.47

References

1. Miyagawa M, Akiyama T, Taoda Y, Takaya K, Takahashi-Kageyama C, Tomita K, Yasuo K, Hattori K, Shano S, Yoshida R, Shishido T, Yoshinaga T, Sato A, Kawai M..  (2019)  Synthesis and SAR Study of Carbamoyl Pyridone Bicycle Derivatives as Potent Inhibitors of Influenza Cap-dependent Endonuclease.,  62  (17): [PMID:31386363] [10.1021/acs.jmedchem.9b00861]

Source