The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-cyclopropyl-1-ethyl-6-(3-methyl-2-oxo-5-(4-(trifluoromethyl)phenyl)-2,3-dihydro-1H-imidazol-1-yl)quinolin-2(1H)-one ID: ALA4521910
PubChem CID: 137541835
Max Phase: Preclinical
Molecular Formula: C25H22F3N3O2
Molecular Weight: 453.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(=O)cc(C2CC2)c2cc(-n3c(-c4ccc(C(F)(F)F)cc4)cn(C)c3=O)ccc21
Standard InChI: InChI=1S/C25H22F3N3O2/c1-3-30-21-11-10-18(12-20(21)19(13-23(30)32)15-4-5-15)31-22(14-29(2)24(31)33)16-6-8-17(9-7-16)25(26,27)28/h6-15H,3-5H2,1-2H3
Standard InChI Key: JPFZBQWINWPMSO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
22.2562 -9.5523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2562 -8.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2543 -7.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2580 -10.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2580 -11.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2499 -11.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2318 -11.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2236 -11.9269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1113 -13.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9874 -13.8667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9690 -13.3444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5024 -14.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3755 -12.3363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1508 -11.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8978 -10.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7604 -9.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5074 -8.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3917 -8.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1386 -6.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0226 -6.5392 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9662 -6.0637 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8358 -5.7608 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5290 -8.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7821 -9.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2318 -10.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2299 -9.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2762 -11.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2762 -13.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7100 -14.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8798 -14.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2743 -11.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2743 -10.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2824 -9.5350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 1 0
5 4 2 0
5 6 1 0
6 7 2 0
7 8 1 0
9 8 1 0
9 10 2 0
9 11 1 0
11 12 1 0
11 13 1 0
13 14 2 0
14 8 1 0
14 15 1 0
15 16 2 0
17 16 1 0
18 17 2 0
18 19 1 0
19 20 1 0
19 21 1 0
19 22 1 0
23 18 1 0
24 23 2 0
15 24 1 0
7 25 1 0
25 26 2 0
26 4 1 0
27 5 1 0
27 28 1 0
28 29 1 0
30 29 1 0
28 30 1 0
31 27 2 0
32 31 1 0
1 32 1 0
32 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.46Molecular Weight (Monoisotopic): 453.1664AlogP: 5.07#Rotatable Bonds: 4Polar Surface Area: 48.93Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.33CX LogD: 4.33Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -1.03
References 1. (2018) Nitrogen-containing heterocyclic compound,