The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3beta-(methoxy)-17-(1H-benzimidazol-1-yl)androsta-5,16-diene ID: ALA4521939
PubChem CID: 118867913
Max Phase: Preclinical
Molecular Formula: C27H34N2O
Molecular Weight: 402.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(n4cnc5ccccc54)=CC[C@@H]32)C1
Standard InChI: InChI=1S/C27H34N2O/c1-26-14-12-19(30-3)16-18(26)8-9-20-21-10-11-25(27(21,2)15-13-22(20)26)29-17-28-23-6-4-5-7-24(23)29/h4-8,11,17,19-22H,9-10,12-16H2,1-3H3/t19-,20-,21-,22-,26-,27-/m0/s1
Standard InChI Key: NXXXAZGYVFACII-ZTFSMFBVSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
10.1312 -9.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5695 -10.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1258 -10.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3598 -9.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4061 -10.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4101 -12.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4135 -11.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8347 -10.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1188 -12.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5478 -11.6603 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.3379 -11.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7016 -10.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9895 -12.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5561 -10.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9895 -11.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8312 -10.4145 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.7016 -12.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8392 -11.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8356 -12.0622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6266 -8.9886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2757 -12.4698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8561 -9.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1187 -11.6437 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.5644 -9.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4104 -8.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4237 -7.9209 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1511 -8.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6445 -7.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3250 -6.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5125 -6.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0204 -7.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3426 -8.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5673 -12.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 19 1 0
6 9 2 0
22 1 1 0
2 14 1 0
3 23 1 6
4 2 1 0
7 5 1 1
14 10 1 6
7 12 1 0
11 8 1 0
18 16 1 1
2 22 1 0
3 1 1 0
2 24 1 1
3 18 1 0
14 11 1 0
15 13 1 0
17 6 1 0
7 6 1 0
15 12 1 0
19 18 1 0
13 21 1 1
13 17 1 0
18 14 1 0
4 20 1 0
7 3 1 0
8 4 2 0
20 25 1 0
25 26 2 0
26 28 1 0
27 20 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
21 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.58Molecular Weight (Monoisotopic): 402.2671AlogP: 6.46#Rotatable Bonds: 2Polar Surface Area: 27.05Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.97CX LogP: 5.11CX LogD: 5.11Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: 1.00
References 1. Purushottamachar P, Kwegyir-Afful AK, Martin MS, Ramamurthy VP, Ramalingam S, Njar VC.. (2016) Identification of Novel Steroidal Androgen Receptor Degrading Agents Inspired by Galeterone 3β-Imidazole Carbamate., 7 (7): [PMID:27437082 ] [10.1021/acsmedchemlett.6b00137 ]