3-(2-chlorophenylthio)-4-hydroxy-6-(4-hydroxyphenyl)-6-(thiophen-3-yl)-5,6-dihydropyridin-2(1H)-one

ID: ALA4521960

PubChem CID: 155542943

Max Phase: Preclinical

Molecular Formula: C21H16ClNO3S2

Molecular Weight: 429.95

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC(c2ccc(O)cc2)(c2ccsc2)CC(O)=C1Sc1ccccc1Cl

Standard InChI:  InChI=1S/C21H16ClNO3S2/c22-16-3-1-2-4-18(16)28-19-17(25)11-21(23-20(19)26,14-9-10-27-12-14)13-5-7-15(24)8-6-13/h1-10,12,24-25H,11H2,(H,23,26)

Standard InChI Key:  NPPKQFGYXIBRKS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   30.5445   -7.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2094   -7.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6893   -8.6353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5045   -8.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8399   -7.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3603   -7.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8367   -9.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1095   -9.7757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9265   -9.7563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.1598   -8.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4854   -8.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7165   -7.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5547   -6.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5535   -7.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2616   -8.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9712   -7.6702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9684   -6.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2598   -6.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8468   -6.4427    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.1392   -6.8515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4273   -6.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7218   -6.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4254   -8.0734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1371   -7.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4284   -5.6227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2573   -5.6251    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.8434   -8.0774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3964   -8.0534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
 12 11  1  0
  5 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 13 19  1  0
 19 20  1  0
 20 21  2  0
 20 24  1  0
 21 22  1  0
 22 12  1  0
 12 23  1  0
 23 24  1  0
 21 25  1  0
 18 26  1  0
 24 27  2  0
  2 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4521960

    ---

Associated Targets(Human)

LDHA Tchem L-lactate dehydrogenase A chain (1573 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
LDHB Tchem L-lactate dehydrogenase B chain (463 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.95Molecular Weight (Monoisotopic): 429.0260AlogP: 5.43#Rotatable Bonds: 4
Polar Surface Area: 69.56Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.95CX Basic pKa: CX LogP: 4.10CX LogD: 2.64
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.52Np Likeness Score: -0.74

References

1. Purkey HE, Robarge K, Chen J, Chen Z, Corson LB, Ding CZ, DiPasquale AG, Dragovich PS, Eigenbrot C, Evangelista M, Fauber BP, Gao Z, Ge H, Hitz A, Ho Q, Labadie SS, Lai KW, Liu W, Liu Y, Li C, Ma S, Malek S, O'Brien T, Pang J, Peterson D, Salphati L, Sideris S, Ultsch M, Wei B, Yen I, Yue Q, Zhang H, Zhou A..  (2016)  Cell Active Hydroxylactam Inhibitors of Human Lactate Dehydrogenase with Oral Bioavailability in Mice.,  (10): [PMID:27774125] [10.1021/acsmedchemlett.6b00190]

Source