1-(4-((5-chloro-4-(quinolin-6-ylamino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(pyridin-3-ylmethyl)urea

ID: ALA4522024

PubChem CID: 155542876

Max Phase: Preclinical

Molecular Formula: C27H23ClN8O2

Molecular Weight: 526.99

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(NC(=O)NCc2cccnc2)ccc1Nc1ncc(Cl)c(Nc2ccc3ncccc3c2)n1

Standard InChI:  InChI=1S/C27H23ClN8O2/c1-38-24-13-20(34-27(37)32-15-17-4-2-10-29-14-17)7-9-23(24)35-26-31-16-21(28)25(36-26)33-19-6-8-22-18(12-19)5-3-11-30-22/h2-14,16H,15H2,1H3,(H2,32,34,37)(H2,31,33,35,36)

Standard InChI Key:  VYQUINABWYPART-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    0.9024   -3.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9013   -4.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6093   -4.6087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3190   -4.1992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3162   -3.3766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6076   -2.9713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0223   -2.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7316   -3.3712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4377   -2.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1470   -3.3659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8532   -2.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5584   -3.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2641   -2.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2614   -2.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5472   -1.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8445   -2.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4347   -2.1428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9731   -3.3580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9758   -4.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9671   -1.7215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6768   -2.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6768   -2.9438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3858   -3.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0924   -2.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0856   -2.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3761   -1.7138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8027   -3.3405    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.7897   -1.7004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5009   -2.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5027   -2.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2131   -3.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1976   -1.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9085   -2.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9156   -2.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6268   -3.3051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3314   -2.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3204   -2.0675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6086   -1.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  2  0
 13 18  1  0
 18 19  1  0
 14 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 34  2  0
 33 32  2  0
 32 29  1  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4522024

    ---

Associated Targets(Human)

NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KARPAS-299 (888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.99Molecular Weight (Monoisotopic): 526.1632AlogP: 5.89#Rotatable Bonds: 8
Polar Surface Area: 125.98Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.75CX Basic pKa: 5.21CX LogP: 4.44CX LogD: 4.44
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -1.79

References

1. Chen H, Li R, Ning X, Zhao X, Jin Y, Yin Y..  (2019)  Synthesis and anti-tumor efficacy of novel 2, 4-diarylaminopyrimidine derivatives bearing N-(3-pyridinylmethyl) urea moiety as anaplastic lymphoma kinase inhibitors.,  178  [PMID:31177074] [10.1016/j.ejmech.2019.05.060]

Source