3-Phenylpropyl 2,3-dihydroxybenzoate

ID: ALA4522037

PubChem CID: 151864630

Max Phase: Preclinical

Molecular Formula: C16H16O4

Molecular Weight: 272.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(OCCCc1ccccc1)c1cccc(O)c1O

Standard InChI:  InChI=1S/C16H16O4/c17-14-10-4-9-13(15(14)18)16(19)20-11-5-8-12-6-2-1-3-7-12/h1-4,6-7,9-10,17-18H,5,8,11H2

Standard InChI Key:  SLKNIBLRFPCSKP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   27.0154  -13.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0143  -14.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7223  -15.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4320  -14.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4292  -13.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7205  -13.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3076  -13.5498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7181  -12.7322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1353  -13.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8446  -13.9493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1322  -12.7262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5507  -13.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2600  -13.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9661  -13.5327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6754  -13.9387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6756  -14.7559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3840  -15.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0911  -14.7504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0854  -13.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3765  -13.5269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  6  8  1  0
  5  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4522037

    ---

Associated Targets(non-human)

PC-12 (7051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 272.30Molecular Weight (Monoisotopic): 272.1049AlogP: 2.89#Rotatable Bonds: 5
Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.27CX Basic pKa: CX LogP: 4.48CX LogD: 4.47
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.50Np Likeness Score: 0.07

References

1. Wang Z, Ma C, Wang Y, Xiao Q, Xu C, Li Y..  (2019)  Structural optimization and neurotrophic activity evaluation of neurotrophic gentiside derivatives.,  29  (22): [PMID:31607606] [10.1016/j.bmcl.2019.126685]

Source