The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((R)-2-((S)-3-amino-7-(4-fluorophenyl)-3-methyl-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-5-yl)-3,3,3-trifluoro-2-hydroxypropyl)-4-(2-hydroxyethoxy)-3-methoxybenzamide ID: ALA4522047
PubChem CID: 122502998
Max Phase: Preclinical
Molecular Formula: C27H28F4N4O5
Molecular Weight: 564.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)NC[C@@](O)(c2cc3c(c(-c4ccc(F)cc4)n2)NC[C@@]3(C)N)C(F)(F)F)ccc1OCCO
Standard InChI: InChI=1S/C27H28F4N4O5/c1-25(32)13-33-23-18(25)12-21(35-22(23)15-3-6-17(28)7-4-15)26(38,27(29,30)31)14-34-24(37)16-5-8-19(40-10-9-36)20(11-16)39-2/h3-8,11-12,33,36,38H,9-10,13-14,32H2,1-2H3,(H,34,37)/t25-,26-/m1/s1
Standard InChI Key: QOOACNYSVGAWOH-CLJLJLNGSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
18.3193 -4.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3182 -5.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0262 -5.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7359 -5.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7331 -4.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0245 -4.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0220 -3.2148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3131 -2.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6115 -4.0324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9039 -4.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1961 -4.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4885 -4.4415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4443 -5.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4455 -6.4846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1513 -5.2577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8597 -5.6652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5667 -5.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2751 -5.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2720 -6.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6836 -5.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9755 -5.2533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6875 -6.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9820 -6.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1571 -7.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9709 -7.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2986 -7.0218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3843 -5.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0944 -5.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7996 -5.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7958 -4.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0811 -4.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3789 -4.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6141 -8.3013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3642 -7.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5655 -4.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2725 -4.0286 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.8571 -4.0308 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5594 -3.6196 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.2693 -4.8412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5009 -4.0107 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
4 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 23 1 0
22 20 1 0
20 21 2 0
21 18 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
20 27 1 0
24 33 1 1
24 34 1 0
17 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
17 39 1 1
30 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.54Molecular Weight (Monoisotopic): 564.1996AlogP: 3.05#Rotatable Bonds: 9Polar Surface Area: 138.96Molecular Species: BASEHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.74CX Basic pKa: 8.94CX LogP: 1.74CX LogD: 0.51Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.52
References 1. Cockerill GS, Good JAD, Mathews N.. (2019) State of the Art in Respiratory Syncytial Virus Drug Discovery and Development., 62 (7): [PMID:30411898 ] [10.1021/acs.jmedchem.8b01361 ]