The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 2-acetamido-3-(1-(2-(trifluoromethyl)phenyl)-1H-1,2,3-triazol-4-yl)-2-((1-(2-(trifluoromethyl)phenyl)-1H-1,2,3-triazol-4-yl)methyl)propanoate ID: ALA4522050
PubChem CID: 155542946
Max Phase: Preclinical
Molecular Formula: C26H23F6N7O3
Molecular Weight: 595.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C(Cc1cn(-c2ccccc2C(F)(F)F)nn1)(Cc1cn(-c2ccccc2C(F)(F)F)nn1)NC(C)=O
Standard InChI: InChI=1S/C26H23F6N7O3/c1-3-42-23(41)24(33-16(2)40,12-17-14-38(36-34-17)21-10-6-4-8-19(21)25(27,28)29)13-18-15-39(37-35-18)22-11-7-5-9-20(22)26(30,31)32/h4-11,14-15H,3,12-13H2,1-2H3,(H,33,40)
Standard InChI Key: WZRIJTZFAPBAMN-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
5.8097 -7.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8086 -8.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5166 -8.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2263 -8.5865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2235 -7.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5148 -7.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5124 -6.5414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2189 -6.1307 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.8035 -6.1349 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.5045 -5.7203 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9296 -7.3525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6770 -7.6796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2215 -7.0702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8102 -6.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0116 -6.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5133 -5.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2256 -6.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9286 -5.9311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2350 -7.1649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9473 -7.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0420 -8.3750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8432 -8.5357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2437 -7.8233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6899 -7.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0586 -7.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4661 -8.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2801 -8.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6865 -7.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2727 -7.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4600 -7.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2190 -5.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9234 -5.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5080 -5.1276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5015 -4.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7905 -3.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6409 -6.3316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3439 -5.9149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0433 -7.0369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0581 -9.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2409 -9.2367 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4672 -9.9434 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.6417 -9.9384 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 9 1 0
7 10 1 0
5 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 11 1 0
14 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 20 2 0
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
17 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
18 36 1 0
36 37 1 0
36 38 2 0
26 39 1 0
39 40 1 0
39 41 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.50Molecular Weight (Monoisotopic): 595.1767AlogP: 4.11#Rotatable Bonds: 9Polar Surface Area: 116.82Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.32CX Basic pKa: 0.35CX LogP: 4.71CX LogD: 4.71Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -0.87
References 1. Xu M, Peng Y, Zhu L, Wang S, Ji J, Rakesh KP.. (2019) Triazole derivatives as inhibitors of Alzheimer's disease: Current developments and structure-activity relationships., 180 [PMID:31352246 ] [10.1016/j.ejmech.2019.07.059 ]