The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(5-(4-acryloylpiperazin-1-yl)-2-(trifluoromethyl)phenyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione ID: ALA4522075
PubChem CID: 155542904
Max Phase: Preclinical
Molecular Formula: C25H20F3N5O3
Molecular Weight: 495.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCN(c2ccc(C(F)(F)F)c(C3=C(c4c[nH]c5ncccc45)C(=O)NC3=O)c2)CC1
Standard InChI: InChI=1S/C25H20F3N5O3/c1-2-19(34)33-10-8-32(9-11-33)14-5-6-18(25(26,27)28)16(12-14)20-21(24(36)31-23(20)35)17-13-30-22-15(17)4-3-7-29-22/h2-7,12-13H,1,8-11H2,(H,29,30)(H,31,35,36)
Standard InChI Key: TZJNLXQOAICYQK-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
15.4977 -13.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3149 -13.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5693 -12.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9063 -12.1877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2476 -12.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4703 -12.4177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3468 -12.4184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7961 -14.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5427 -14.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2033 -15.3658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6133 -14.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8639 -14.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6601 -15.0553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2066 -14.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9512 -13.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1556 -13.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0171 -14.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2035 -14.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7225 -14.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0538 -15.4237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8709 -15.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3483 -14.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7648 -13.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3652 -12.6943 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0331 -12.5106 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.9166 -13.2220 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.2053 -16.2530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7273 -16.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0584 -17.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8706 -17.7403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3507 -17.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0186 -16.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2023 -18.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7215 -19.1478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0150 -18.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3468 -19.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
5 6 2 0
3 7 2 0
8 9 2 0
9 10 1 0
10 12 1 0
11 8 1 0
2 8 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
1 17 1 0
23 24 1 0
23 25 1 0
23 26 1 0
18 23 1 0
21 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
30 33 1 0
33 34 2 0
33 35 1 0
35 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.46Molecular Weight (Monoisotopic): 495.1518AlogP: 2.98#Rotatable Bonds: 4Polar Surface Area: 98.40Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.87CX Basic pKa: 3.18CX LogP: 2.77CX LogD: 2.76Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: -0.71
References 1. Shi L, Zhong Z, Li X, Zhou Y, Pan Z.. (2019) Discovery of an Orally Available Janus Kinase 3 Selective Covalent Inhibitor., 62 (2): [PMID:30615446 ] [10.1021/acs.jmedchem.8b01823 ]