The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-Hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxybenzyl)-1,3-dihydro-2H-imidazo[4,5-c]pyridin-2-one ID: ALA4522095
PubChem CID: 155542832
Max Phase: Preclinical
Molecular Formula: C23H23N3O6
Molecular Weight: 437.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cncc3[nH]c(=O)n(Cc4cc(OC)c(OC)c(OC)c4)c23)cc1O
Standard InChI: InChI=1S/C23H23N3O6/c1-29-18-6-5-14(9-17(18)27)15-10-24-11-16-21(15)26(23(28)25-16)12-13-7-19(30-2)22(32-4)20(8-13)31-3/h5-11,27H,12H2,1-4H3,(H,25,28)
Standard InChI Key: GEXPFDCFSDLTMU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
26.3397 -4.5096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0494 -4.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0465 -3.2775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3379 -2.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3414 -5.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6319 -5.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6314 -6.5489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3395 -6.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0497 -6.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0468 -5.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6317 -4.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6284 -3.2841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8508 -3.0349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3735 -3.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8561 -4.3560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5563 -3.7008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3404 -7.7757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0486 -8.1835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7587 -6.9519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6068 -5.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8081 -5.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2645 -4.7010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4665 -4.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2164 -5.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7705 -6.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5664 -6.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5239 -7.0381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7259 -7.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4180 -5.8268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8680 -5.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9175 -4.2684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1673 -3.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 12 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 5 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
14 16 2 0
8 17 1 0
17 18 1 0
9 19 1 0
15 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
25 27 1 0
27 28 1 0
24 29 1 0
29 30 1 0
23 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.45Molecular Weight (Monoisotopic): 437.1587AlogP: 3.18#Rotatable Bonds: 7Polar Surface Area: 107.83Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.68CX Basic pKa: 3.58CX LogP: 2.41CX LogD: 2.41Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.11
References 1. Gao F, Liang Y, Zhou P, Cheng J, Ding K, Wang Y.. (2019) Design, synthesis, antitumor activities and biological studies of novel diaryl substituted fused heterocycles as dual ligands targeting tubulin and katanin., 178 [PMID:31185410 ] [10.1016/j.ejmech.2019.05.072 ]