(E)-N-(4-((dimethylamino)methyl)phenyl)-2-(pyridin-2-ylmethylene)hydrazinecarboxamide

ID: ALA4522100

PubChem CID: 155542919

Max Phase: Preclinical

Molecular Formula: C16H19N5O

Molecular Weight: 297.36

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)Cc1ccc(NC(=O)N/N=C/c2ccccn2)cc1

Standard InChI:  InChI=1S/C16H19N5O/c1-21(2)12-13-6-8-14(9-7-13)19-16(22)20-18-11-15-5-3-4-10-17-15/h3-11H,12H2,1-2H3,(H2,19,20,22)/b18-11+

Standard InChI Key:  BUHQLNGBZAMBRM-WOJGMQOQSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
    3.1229  -25.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1217  -25.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8298  -26.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5395  -25.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5366  -25.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8280  -24.7424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4151  -24.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7075  -25.1516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2478  -26.3778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9549  -25.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6632  -26.3756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9536  -25.1509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3703  -25.9659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0786  -26.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7857  -25.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4912  -26.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1978  -25.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1970  -25.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4836  -24.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7800  -25.1483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9997  -24.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7077  -25.9688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  8 21  1  0
  8 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4522100

    ---

Associated Targets(Human)

U-937 (7138 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 297.36Molecular Weight (Monoisotopic): 297.1590AlogP: 2.30#Rotatable Bonds: 5
Polar Surface Area: 69.62Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.17CX Basic pKa: 8.71CX LogP: 2.41CX LogD: 1.08
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.66Np Likeness Score: -2.19

References

1. Ma J, Ni X, Gao Y, Huang K, Liu J, Wang Y, Chen R, Wang C..  (2019)  Identification and biological evaluation of novel benzothiazole derivatives bearing a pyridine-semicarbazone moiety as apoptosis inducers via activation of procaspase-3 to caspase-3.,  10  (3): [PMID:31015910] [10.1039/C8MD00624E]

Source