The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-Benzyl-(4-((2-(hydroxycarbamoyl)pyrrolidin-1-yl)sulfonyl)phenyl)carbamate ID: ALA4522121
PubChem CID: 155542845
Max Phase: Preclinical
Molecular Formula: C28H29N3O7S
Molecular Weight: 551.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccc(C(=O)Nc2ccc(S(=O)(=O)C3CCC[C@@H]3C(=O)NO)cc2)cc1)OCc1ccccc1
Standard InChI: InChI=1S/C28H29N3O7S/c32-26(21-11-9-19(10-12-21)17-29-28(34)38-18-20-5-2-1-3-6-20)30-22-13-15-23(16-14-22)39(36,37)25-8-4-7-24(25)27(33)31-35/h1-3,5-6,9-16,24-25,35H,4,7-8,17-18H2,(H,29,34)(H,30,32)(H,31,33)/t24-,25?/m0/s1
Standard InChI Key: BEQHTXZKGHKYDJ-SKCDSABHSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
24.1773 -3.1119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4674 -3.5288 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.1819 -3.9336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1632 -2.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9845 -2.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2430 -2.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5759 -1.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9130 -2.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0280 -1.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6346 -2.3778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1991 -1.0269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9807 -0.7713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1308 -4.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3128 -4.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9796 -5.1098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4634 -5.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2843 -5.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6138 -4.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1270 -6.5232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6116 -7.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2752 -7.9391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4284 -7.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9031 -7.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7192 -7.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0563 -6.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5672 -6.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7528 -6.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8730 -6.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3544 -7.5100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1711 -7.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6565 -8.0838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5065 -6.6722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4732 -7.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9587 -8.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6196 -9.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1043 -10.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9219 -9.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2525 -9.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7699 -8.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
9 10 2 0
9 11 1 0
6 9 1 6
11 12 1 0
5 2 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.62Molecular Weight (Monoisotopic): 551.1726AlogP: 3.81#Rotatable Bonds: 9Polar Surface Area: 150.90Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.86CX Basic pKa: ┄CX LogP: 3.42CX LogD: 3.41Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -0.88
References 1. Lenci E, Innocenti R, Di Francescantonio T, Menchi G, Bianchini F, Contini A, Trabocchi A.. (2019) Identification of highly potent and selective MMP2 inhibitors addressing the S1' subsite with d-proline-based compounds., 27 (9): [PMID:30926311 ] [10.1016/j.bmc.2019.03.043 ]