The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((5,6-Bis(4-(furan-3-yl)phenyl)pyrazin-2-yl)methyl)piperidin-4-amine ID: ALA4522123
PubChem CID: 155542846
Max Phase: Preclinical
Molecular Formula: C31H30N4O2
Molecular Weight: 490.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: c1cc(-c2ccc(-c3ncc(CNCC4CCNCC4)nc3-c3ccc(-c4ccoc4)cc3)cc2)co1
Standard InChI: InChI=1S/C31H30N4O2/c1-5-25(6-2-23(1)27-11-15-36-20-27)30-31(26-7-3-24(4-8-26)28-12-16-37-21-28)35-29(19-34-30)18-33-17-22-9-13-32-14-10-22/h1-8,11-12,15-16,19-22,32-33H,9-10,13-14,17-18H2
Standard InChI Key: FBZWIWQBQTUCKA-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
18.4927 -14.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4916 -14.9553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1996 -15.3642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9093 -14.9548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9064 -14.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1978 -13.7269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7870 -13.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7881 -12.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0811 -12.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3725 -12.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3754 -13.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0829 -14.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7854 -15.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0777 -14.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3702 -15.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3691 -16.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0815 -16.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7861 -16.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6635 -12.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5768 -11.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7772 -11.5225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3697 -12.2309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9175 -12.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6629 -16.5923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9161 -16.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3696 -16.8679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7787 -17.5755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5778 -17.4050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6176 -15.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3247 -14.9526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0330 -15.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7401 -14.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4484 -15.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7388 -14.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4459 -13.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1542 -14.1309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1555 -14.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
1 7 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 13 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 19 2 0
10 19 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 24 1 0
16 24 1 0
4 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
34 35 1 0
33 37 1 0
35 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.61Molecular Weight (Monoisotopic): 490.2369AlogP: 6.42#Rotatable Bonds: 8Polar Surface Area: 76.12Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.37CX LogP: 4.92CX LogD: 0.63Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.18
References 1. Wu F, Hua Y, Kaochar S, Nie S, Lin YL, Yao Y, Wu J, Wu X, Fu X, Schiff R, Davis CM, Robertson M, Ehli EA, Coarfa C, Mitsiades N, Song Y.. (2020) Discovery, Structure-Activity Relationship, and Biological Activity of Histone-Competitive Inhibitors of Histone Acetyltransferases P300/CBP., 63 (9): [PMID:32314924 ] [10.1021/acs.jmedchem.9b02164 ]