The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-Chlorobenzamido)-6-((2-fluorophenyl)carbamothioyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide ID: ALA4522209
PubChem CID: 155542816
Max Phase: Preclinical
Molecular Formula: C22H18ClFN4O2S2
Molecular Weight: 489.00
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(NC(=O)c2ccccc2Cl)sc2c1CCN(C(=S)Nc1ccccc1F)C2
Standard InChI: InChI=1S/C22H18ClFN4O2S2/c23-14-6-2-1-5-12(14)20(30)27-21-18(19(25)29)13-9-10-28(11-17(13)32-21)22(31)26-16-8-4-3-7-15(16)24/h1-8H,9-11H2,(H2,25,29)(H,26,31)(H,27,30)
Standard InChI Key: CYIDDZZTPCLBMZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
31.6022 -21.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6022 -22.7163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3116 -23.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3116 -21.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0210 -21.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0255 -22.7127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8048 -22.9600 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.2795 -22.2949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7976 -21.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1008 -22.2904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5175 -23.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3388 -22.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1086 -23.7140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0458 -20.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4916 -20.2482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8483 -20.6782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8956 -23.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7478 -23.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5684 -23.7017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9760 -22.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5570 -22.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7378 -22.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3215 -21.5807 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.8978 -23.9440 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.1868 -22.7201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4802 -23.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7729 -22.7223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0668 -23.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0686 -23.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7824 -24.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4855 -23.9446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7719 -21.9052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 2 0
14 16 1 0
2 17 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
22 23 1 0
17 24 2 0
17 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.00Molecular Weight (Monoisotopic): 488.0544AlogP: 4.65#Rotatable Bonds: 4Polar Surface Area: 87.46Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.48CX Basic pKa: ┄CX LogP: 5.40CX LogD: 5.40Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -2.40
References 1. Wang G, Zhao Y, Liu Y, Sun D, Zhen Y, Liu J, Fu L, Zhang L, Ouyang L.. (2020) Discovery of a Novel Dual-Target Inhibitor of ERK1 and ERK5 That Induces Regulated Cell Death to Overcome Compensatory Mechanism in Specific Tumor Types., 63 (8): [PMID:32078308 ] [10.1021/acs.jmedchem.9b01896 ]