(E)-Ethyl-3-(3-(3-chloroquinoxalin-2-yl)-1-isopropyl-5-methoxy-1H-indol-2-yl)acrylate

ID: ALA4522251

PubChem CID: 155542965

Max Phase: Preclinical

Molecular Formula: C25H24ClN3O3

Molecular Weight: 449.94

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)/C=C/c1c(-c2nc3ccccc3nc2Cl)c2cc(OC)ccc2n1C(C)C

Standard InChI:  InChI=1S/C25H24ClN3O3/c1-5-32-22(30)13-12-21-23(24-25(26)28-19-9-7-6-8-18(19)27-24)17-14-16(31-4)10-11-20(17)29(21)15(2)3/h6-15H,5H2,1-4H3/b13-12+

Standard InChI Key:  DGCXEBQJFQXWOX-OUKQBFOZSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   36.5947   -9.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5936  -10.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3057  -10.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3040   -9.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0126   -9.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0133  -10.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7260  -10.7109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4384  -10.2960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4337   -9.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7204   -9.0664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.1514  -10.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2400  -11.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0442  -11.6869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.9008  -10.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4514  -10.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2518  -10.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5027  -10.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9470   -9.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1487   -9.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1430   -9.0568    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   41.3844  -12.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2016  -12.5173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1992   -8.6305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.0017   -8.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9032  -13.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6308  -12.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8526  -11.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2433  -12.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4610  -12.1236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.4163  -13.1759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8071  -13.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9801  -14.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 15  1  0
 14 11  1  0
  8 11  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  9 20  1  0
 13 21  1  0
 21 22  1  0
 18 23  1  0
 23 24  1  0
 21 25  1  0
 12 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4522251

    ---

Associated Targets(Human)

PDE4B Tclin Phosphodiesterase 4B (2748 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.94Molecular Weight (Monoisotopic): 449.1506AlogP: 6.07#Rotatable Bonds: 6
Polar Surface Area: 66.24Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.91CX LogD: 5.91
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.68

References

1. Sunke R, Bankala R, Thirupataiah B, Ramarao EVVS, Kumar JS, Doss HM, Medishetti R, Kulkarni P, Kapavarapu RK, Rasool M, Mudgal J, Mathew JE, Shenoy GG, Parsa KVL, Pal M..  (2019)  InCl3 mediated heteroarylation of indoles and their derivatization via CH activation strategy: Discovery of 2-(1H-indol-3-yl)-quinoxaline derivatives as a new class of PDE4B selective inhibitors for arthritis and/or multiple sclerosis.,  174  [PMID:31035240] [10.1016/j.ejmech.2019.04.020]

Source