The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-Ethyl-3-(3-(3-chloroquinoxalin-2-yl)-1-isopropyl-5-methoxy-1H-indol-2-yl)acrylate ID: ALA4522251
PubChem CID: 155542965
Max Phase: Preclinical
Molecular Formula: C25H24ClN3O3
Molecular Weight: 449.94
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)/C=C/c1c(-c2nc3ccccc3nc2Cl)c2cc(OC)ccc2n1C(C)C
Standard InChI: InChI=1S/C25H24ClN3O3/c1-5-32-22(30)13-12-21-23(24-25(26)28-19-9-7-6-8-18(19)27-24)17-14-16(31-4)10-11-20(17)29(21)15(2)3/h6-15H,5H2,1-4H3/b13-12+
Standard InChI Key: DGCXEBQJFQXWOX-OUKQBFOZSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
36.5947 -9.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5936 -10.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3057 -10.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3040 -9.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0126 -9.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0133 -10.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7260 -10.7109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4384 -10.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4337 -9.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7204 -9.0664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.1514 -10.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2400 -11.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0442 -11.6869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9008 -10.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4514 -10.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2518 -10.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5027 -10.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9470 -9.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1487 -9.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1430 -9.0568 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
41.3844 -12.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2016 -12.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1992 -8.6305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.0017 -8.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9032 -13.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6308 -12.0734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8526 -11.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2433 -12.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4610 -12.1236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4163 -13.1759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8071 -13.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9801 -14.5320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 2 0
12 13 1 0
13 15 1 0
14 11 1 0
8 11 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
9 20 1 0
13 21 1 0
21 22 1 0
18 23 1 0
23 24 1 0
21 25 1 0
12 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.94Molecular Weight (Monoisotopic): 449.1506AlogP: 6.07#Rotatable Bonds: 6Polar Surface Area: 66.24Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.91CX LogD: 5.91Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.68
References 1. Sunke R, Bankala R, Thirupataiah B, Ramarao EVVS, Kumar JS, Doss HM, Medishetti R, Kulkarni P, Kapavarapu RK, Rasool M, Mudgal J, Mathew JE, Shenoy GG, Parsa KVL, Pal M.. (2019) InCl3 mediated heteroarylation of indoles and their derivatization via CH activation strategy: Discovery of 2-(1H-indol-3-yl)-quinoxaline derivatives as a new class of PDE4B selective inhibitors for arthritis and/or multiple sclerosis., 174 [PMID:31035240 ] [10.1016/j.ejmech.2019.04.020 ]