N-((3-(5-Fluoropyridin-3-yl)-5-methylphenyl)sulfonyl)-2-(naphthalen-2-yloxy)acetamide

ID: ALA4522269

PubChem CID: 155543027

Max Phase: Preclinical

Molecular Formula: C24H19FN2O4S

Molecular Weight: 450.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cncc(F)c2)cc(S(=O)(=O)NC(=O)COc2ccc3ccccc3c2)c1

Standard InChI:  InChI=1S/C24H19FN2O4S/c1-16-8-19(20-10-21(25)14-26-13-20)12-23(9-16)32(29,30)27-24(28)15-31-22-7-6-17-4-2-3-5-18(17)11-22/h2-14H,15H2,1H3,(H,27,28)

Standard InChI Key:  LQBJVNQSVUTKCW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   33.6906  -27.0787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1033  -27.7886    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.5117  -27.0763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9819  -28.2014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6896  -27.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3973  -28.2014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8127  -28.2014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8077  -29.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5163  -29.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2294  -29.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2295  -28.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5203  -27.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2742  -27.7928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5665  -28.2014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8593  -27.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8644  -29.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5687  -29.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1517  -29.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1561  -28.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4529  -27.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7447  -28.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7442  -29.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4480  -29.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6896  -26.9756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5132  -30.2530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9341  -27.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6422  -28.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3493  -27.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3495  -26.9808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6368  -26.5725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9325  -26.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0569  -28.2076    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 18  2  0
  5 24  2  0
  9 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 11 26  1  0
 28 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4522269

    ---

Associated Targets(Human)

RAPGEF3 Tchem Rap guanine nucleotide exchange factor 3 (15528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.49Molecular Weight (Monoisotopic): 450.1050AlogP: 4.23#Rotatable Bonds: 6
Polar Surface Area: 85.36Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.93CX Basic pKa: 2.28CX LogP: 4.05CX LogD: 3.22
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.40

References

1. Wang P, Luchowska-Stańska U, van Basten B, Chen H, Liu Z, Wiejak J, Whelan P, Morgan D, Lochhead E, Barker G, Rehmann H, Yarwood SJ, Zhou J..  (2020)  Synthesis and Biochemical Evaluation of Noncyclic Nucleotide Exchange Proteins Directly Activated by cAMP 1 (EPAC1) Regulators.,  63  (10): [PMID:32340447] [10.1021/acs.jmedchem.9b02094]

Source