The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3-(5-Fluoropyridin-3-yl)-5-methylphenyl)sulfonyl)-2-(naphthalen-2-yloxy)acetamide ID: ALA4522269
PubChem CID: 155543027
Max Phase: Preclinical
Molecular Formula: C24H19FN2O4S
Molecular Weight: 450.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(-c2cncc(F)c2)cc(S(=O)(=O)NC(=O)COc2ccc3ccccc3c2)c1
Standard InChI: InChI=1S/C24H19FN2O4S/c1-16-8-19(20-10-21(25)14-26-13-20)12-23(9-16)32(29,30)27-24(28)15-31-22-7-6-17-4-2-3-5-18(17)11-22/h2-14H,15H2,1H3,(H,27,28)
Standard InChI Key: LQBJVNQSVUTKCW-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
33.6906 -27.0787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1033 -27.7886 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.5117 -27.0763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9819 -28.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6896 -27.7928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3973 -28.2014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8127 -28.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8077 -29.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5163 -29.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2294 -29.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2295 -28.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5203 -27.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2742 -27.7928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5665 -28.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8593 -27.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8644 -29.4241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5687 -29.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1517 -29.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1561 -28.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4529 -27.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7447 -28.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7442 -29.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4480 -29.4198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6896 -26.9756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5132 -30.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9341 -27.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6422 -28.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3493 -27.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3495 -26.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6368 -26.5725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9325 -26.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0569 -28.2076 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 2 1 0
2 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 13 1 0
13 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 18 2 0
5 24 2 0
9 25 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
11 26 1 0
28 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.49Molecular Weight (Monoisotopic): 450.1050AlogP: 4.23#Rotatable Bonds: 6Polar Surface Area: 85.36Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.93CX Basic pKa: 2.28CX LogP: 4.05CX LogD: 3.22Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.40
References 1. Wang P, Luchowska-Stańska U, van Basten B, Chen H, Liu Z, Wiejak J, Whelan P, Morgan D, Lochhead E, Barker G, Rehmann H, Yarwood SJ, Zhou J.. (2020) Synthesis and Biochemical Evaluation of Noncyclic Nucleotide Exchange Proteins Directly Activated by cAMP 1 (EPAC1) Regulators., 63 (10): [PMID:32340447 ] [10.1021/acs.jmedchem.9b02094 ]