The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1E,4E)-6-(1-(2-thiophenecarbonylthio)nonyl)-5,8-dimethoxy-1,4-naphthoquinone-dioxime ID: ALA4522322
PubChem CID: 155542997
Max Phase: Preclinical
Molecular Formula: C26H32N2O5S2
Molecular Weight: 516.69
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCC(SC(=O)c1cccs1)c1cc(OC)c2c(c1OC)/C(=N/O)C=C/C2=N\O
Standard InChI: InChI=1S/C26H32N2O5S2/c1-4-5-6-7-8-9-11-21(35-26(29)22-12-10-15-34-22)17-16-20(32-2)23-18(27-30)13-14-19(28-31)24(23)25(17)33-3/h10,12-16,21,30-31H,4-9,11H2,1-3H3/b27-18+,28-19+
Standard InChI Key: QONZBEUWMQVQRJ-UKOHILRMSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
33.2945 -14.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0109 -14.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0080 -13.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2927 -13.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5797 -14.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5839 -13.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8734 -13.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1542 -13.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1500 -14.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8651 -14.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8621 -15.5642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1461 -15.9741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8786 -12.2595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1668 -11.8425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2894 -12.2618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0024 -11.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2943 -15.5647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7260 -14.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7273 -15.5627 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.5797 -15.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4398 -14.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4424 -15.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1562 -15.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4437 -16.7991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4385 -13.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1523 -13.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1510 -12.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8649 -11.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8635 -11.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5773 -10.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2924 -11.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9083 -15.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4594 -15.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0458 -14.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2391 -14.7359 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 13 2 0
13 14 1 0
4 15 1 0
15 16 1 0
1 17 1 0
2 18 1 0
18 19 1 0
17 20 1 0
18 21 1 0
19 22 1 0
22 23 1 0
22 24 2 0
21 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
23 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.69Molecular Weight (Monoisotopic): 516.1753AlogP: 7.06#Rotatable Bonds: 12Polar Surface Area: 100.71Molecular Species: ACIDHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.96CX Basic pKa: ┄CX LogP: 6.99CX LogD: 4.70Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: -0.05
References 1. Huang G, Dong JY, Zhang QJ, Meng QQ, Zhao HR, Zhu BQ, Li SS.. (2019) Discovery and synthesis of sulfur-containing 6-substituted 5,8-dimethoxy-1,4-naphthoquinone oxime derivatives as new and potential anti-MDR cancer agents., 165 [PMID:30677614 ] [10.1016/j.ejmech.2019.01.005 ]