The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-Seco-olean-12-en-2,3-dial-28-oic acid benzylamide ID: ALA4522434
PubChem CID: 155543058
Max Phase: Preclinical
Molecular Formula: C37H53NO3
Molecular Weight: 559.84
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC[C@]2(C(=O)NCc3ccccc3)CC[C@]3(C)C(=CC[C@@H]4[C@@](C)(CC=O)[C@H](C(C)(C)C=O)CC[C@]43C)[C@@H]2C1
Standard InChI: InChI=1S/C37H53NO3/c1-32(2)17-19-37(31(41)38-24-26-11-9-8-10-12-26)20-18-35(6)27(28(37)23-32)13-14-30-34(5,21-22-39)29(33(3,4)25-40)15-16-36(30,35)7/h8-13,22,25,28-30H,14-21,23-24H2,1-7H3,(H,38,41)/t28-,29-,30+,34-,35+,36+,37-/m0/s1
Standard InChI Key: CBWXCLWKRPPRKP-RSDHPSSXSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
18.0896 -19.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0896 -20.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7949 -20.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7949 -18.9027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5043 -19.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5054 -20.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2138 -20.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9257 -20.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2117 -18.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9204 -19.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9282 -17.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2125 -18.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6369 -18.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6264 -18.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3249 -19.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0382 -18.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3458 -17.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0455 -18.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7517 -17.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7684 -16.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0728 -16.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3563 -16.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4970 -18.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9127 -18.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3784 -20.5505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7481 -18.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6308 -17.2807 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.6184 -19.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2069 -19.7240 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.3785 -21.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1999 -21.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7480 -19.3443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4599 -18.1144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6544 -15.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4757 -15.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3766 -18.9089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1717 -18.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8836 -18.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5940 -18.5275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3054 -18.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3059 -17.2974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5891 -16.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8806 -17.2992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 1 0
2 3 1 0
6 3 1 1
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 2 0
11 12 1 0
13 14 1 0
13 17 1 0
14 15 1 0
15 16 1 0
16 18 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
5 23 1 1
10 24 1 1
2 25 2 0
18 26 1 1
17 27 1 1
14 28 1 6
9 29 1 6
3 30 1 0
3 31 1 0
26 32 2 0
26 33 1 0
21 34 1 0
21 35 1 0
1 36 2 0
33 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.84Molecular Weight (Monoisotopic): 559.4025AlogP: 8.10#Rotatable Bonds: 7Polar Surface Area: 63.24Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.40CX LogP: 6.98CX LogD: 6.98Aromatic Rings: 1Heavy Atoms: 41QED Weighted: 0.27Np Likeness Score: 2.13
References 1. Sommerwerk S, Heller L, Kuhfs J, Csuk R.. (2016) Urea derivates of ursolic, oleanolic and maslinic acid induce apoptosis and are selective cytotoxic for several human tumor cell lines., 119 [PMID:27149037 ] [10.1016/j.ejmech.2016.04.051 ]