The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(4-(2-(difluoromethyl)-1H-benzo[d]imidazol-1-yl)-6-morpholino-1,3,5-triazin-2-yl)piperidine-3-carboxylic acid ID: ALA4522571
PubChem CID: 155543659
Max Phase: Preclinical
Molecular Formula: C21H23F2N7O3
Molecular Weight: 459.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)[C@H]1CCCN(c2nc(N3CCOCC3)nc(-n3c(C(F)F)nc4ccccc43)n2)C1
Standard InChI: InChI=1S/C21H23F2N7O3/c22-16(23)17-24-14-5-1-2-6-15(14)30(17)21-26-19(28-8-10-33-11-9-28)25-20(27-21)29-7-3-4-13(12-29)18(31)32/h1-2,5-6,13,16H,3-4,7-12H2,(H,31,32)/t13-/m0/s1
Standard InChI Key: LZPFNUFLUGZHSO-ZDUSSCGKSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
36.5988 -3.3471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5977 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3057 -4.5756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0154 -4.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0126 -3.3435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3040 -2.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3015 -2.1211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0060 -1.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0055 -0.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2984 -0.4894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5901 -0.8989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5889 -1.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8897 -4.5747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7238 -4.5737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1419 -4.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5946 -4.8501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7208 -5.3910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4251 -5.7984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1345 -5.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1352 -4.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4264 -4.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8021 -5.3888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0028 -5.5558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7494 -6.3301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2942 -6.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0958 -6.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3455 -5.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9717 -3.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5788 -2.8969 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.1944 -3.1917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.8437 -4.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5506 -4.5767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8452 -3.3496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
2 13 1 0
4 14 1 0
13 15 1 0
15 16 2 0
16 23 1 0
22 13 1 0
14 17 1 0
14 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
15 28 1 0
28 29 1 0
28 30 1 0
20 31 1 1
31 32 1 0
31 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.46Molecular Weight (Monoisotopic): 459.1830AlogP: 2.29#Rotatable Bonds: 5Polar Surface Area: 109.50Molecular Species: ACIDHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.70CX Basic pKa: 5.93CX LogP: 1.87CX LogD: 0.66Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -1.37
References 1. Miller MS, Mountford SJ, Pinson JA, Zheng Z, Künzli M, Patel V, Hogg SJ, Shortt J, Jennings IG, Thompson PE.. (2016) Development of single and mixed isoform selectivity PI3Kδ inhibitors by targeting Asn836 of PI3Kδ., 26 (19): [PMID:27561716 ] [10.1016/j.bmcl.2016.08.028 ]