The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((3,5-Bis(trifluoromethyl)phenyl)carbamothioyl)-2-(3-nitrobenzamido)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide ID: ALA4522633
PubChem CID: 155543625
Max Phase: Preclinical
Molecular Formula: C24H17F6N5O4S2
Molecular Weight: 617.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(NC(=O)c2cccc([N+](=O)[O-])c2)sc2c1CCN(C(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2
Standard InChI: InChI=1S/C24H17F6N5O4S2/c25-23(26,27)12-7-13(24(28,29)30)9-14(8-12)32-22(40)34-5-4-16-17(10-34)41-21(18(16)19(31)36)33-20(37)11-2-1-3-15(6-11)35(38)39/h1-3,6-9H,4-5,10H2,(H2,31,36)(H,32,40)(H,33,37)
Standard InChI Key: KRCLPQGELMXRSO-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
19.6456 -10.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6456 -10.9413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3550 -11.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3550 -9.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0644 -10.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0689 -10.9377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8482 -11.1850 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.3229 -10.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8410 -9.8644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1442 -10.5154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5609 -11.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3822 -11.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1521 -11.9391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0893 -9.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5350 -8.4733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8918 -8.9032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9390 -11.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7913 -11.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6118 -11.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0194 -11.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6004 -10.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7812 -10.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2302 -10.9451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5236 -11.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8163 -10.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1102 -11.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1120 -12.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8258 -12.5818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5290 -12.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9412 -12.1690 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.4016 -10.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3998 -10.1330 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.6993 -11.3603 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.8309 -13.3989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1257 -13.8119 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.5411 -13.8031 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.8267 -14.2142 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.6888 -10.5409 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.0021 -9.7889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5871 -9.0849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8192 -9.7815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 2 0
14 16 1 0
2 17 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
17 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
17 30 2 0
26 31 1 0
31 32 1 0
31 33 1 0
28 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
31 38 1 0
39 40 2 0
39 41 1 0
21 39 1 0
M CHG 2 39 1 41 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 617.55Molecular Weight (Monoisotopic): 617.0626AlogP: 5.80#Rotatable Bonds: 5Polar Surface Area: 130.60Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.10CX Basic pKa: ┄CX LogP: 6.35CX LogD: 6.35Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.14Np Likeness Score: -2.02
References 1. Wang G, Zhao Y, Liu Y, Sun D, Zhen Y, Liu J, Fu L, Zhang L, Ouyang L.. (2020) Discovery of a Novel Dual-Target Inhibitor of ERK1 and ERK5 That Induces Regulated Cell Death to Overcome Compensatory Mechanism in Specific Tumor Types., 63 (8): [PMID:32078308 ] [10.1021/acs.jmedchem.9b01896 ]