4-(5-((5-(4,5-Dimethyl-2-nitrophenyl)furan-2-yl)methylene)-2,4-dioxothiazolidin-3-yl)benzoic acid

ID: ALA4522651

PubChem CID: 155543664

Max Phase: Preclinical

Molecular Formula: C23H16N2O7S

Molecular Weight: 464.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2ccc(/C=C3/SC(=O)N(c4ccc(C(=O)O)cc4)C3=O)o2)c([N+](=O)[O-])cc1C

Standard InChI:  InChI=1S/C23H16N2O7S/c1-12-9-17(18(25(30)31)10-13(12)2)19-8-7-16(32-19)11-20-21(26)24(23(29)33-20)15-5-3-14(4-6-15)22(27)28/h3-11H,1-2H3,(H,27,28)/b20-11+

Standard InChI Key:  UACAOFPCDDPKNB-RGVLZGJSSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   14.5553  -15.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5542  -16.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2663  -16.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9801  -16.2384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9773  -15.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2646  -15.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2590  -14.1877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9228  -13.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6679  -12.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8465  -12.9232    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.5923  -13.7052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1463  -12.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9634  -12.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3747  -13.0532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1777  -12.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2606  -12.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5090  -11.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7858  -13.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6167  -14.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2290  -14.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0105  -14.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1763  -13.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5627  -13.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7048  -13.9556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7296  -12.3624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1150  -11.8150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5053  -12.1013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2661  -17.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5583  -17.8775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9738  -17.8779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8154  -13.9584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6213  -15.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0622  -15.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  6  7  1  0
  9 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  2  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
  8 24  2  0
 25 26  2  0
 25 27  1  0
 23 25  1  0
  3 28  1  0
 28 29  1  0
 28 30  2  0
 11 31  2  0
 21 32  1  0
 20 33  1  0
M  CHG  2  25   1  27  -1
M  END

Alternative Forms

  1. Parent:

    ALA4522651

    ---

Associated Targets(Human)

EP300 Tchem Histone acetyltransferase p300 (1259 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.46Molecular Weight (Monoisotopic): 464.0678AlogP: 5.41#Rotatable Bonds: 5
Polar Surface Area: 130.96Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.00CX Basic pKa: CX LogP: 4.98CX LogD: 1.82
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -1.42

References

1. Liu R, Zhang Z, Yang H, Zhou K, Geng M, Zhou W, Zhang M, Huang X, Li Y..  (2019)  Design, synthesis, and biological evaluation of a new class of histone acetyltransferase p300 inhibitors.,  180  [PMID:31306905] [10.1016/j.ejmech.2019.07.026]

Source