The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-((5-(4,5-Dimethyl-2-nitrophenyl)furan-2-yl)methylene)-2,4-dioxothiazolidin-3-yl)benzoic acid ID: ALA4522651
PubChem CID: 155543664
Max Phase: Preclinical
Molecular Formula: C23H16N2O7S
Molecular Weight: 464.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(-c2ccc(/C=C3/SC(=O)N(c4ccc(C(=O)O)cc4)C3=O)o2)c([N+](=O)[O-])cc1C
Standard InChI: InChI=1S/C23H16N2O7S/c1-12-9-17(18(25(30)31)10-13(12)2)19-8-7-16(32-19)11-20-21(26)24(23(29)33-20)15-5-3-14(4-6-15)22(27)28/h3-11H,1-2H3,(H,27,28)/b20-11+
Standard InChI Key: UACAOFPCDDPKNB-RGVLZGJSSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
14.5553 -15.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5542 -16.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2663 -16.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9801 -16.2384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9773 -15.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2646 -15.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2590 -14.1877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9228 -13.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6679 -12.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8465 -12.9232 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.5923 -13.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1463 -12.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9634 -12.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3747 -13.0532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1777 -12.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2606 -12.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5090 -11.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7858 -13.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6167 -14.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2290 -14.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0105 -14.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1763 -13.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5627 -13.1706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7048 -13.9556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7296 -12.3624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1150 -11.8150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5053 -12.1013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2661 -17.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5583 -17.8775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9738 -17.8779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8154 -13.9584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6213 -15.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0622 -15.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
6 7 1 0
9 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 2 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
8 24 2 0
25 26 2 0
25 27 1 0
23 25 1 0
3 28 1 0
28 29 1 0
28 30 2 0
11 31 2 0
21 32 1 0
20 33 1 0
M CHG 2 25 1 27 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.46Molecular Weight (Monoisotopic): 464.0678AlogP: 5.41#Rotatable Bonds: 5Polar Surface Area: 130.96Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.00CX Basic pKa: ┄CX LogP: 4.98CX LogD: 1.82Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -1.42
References 1. Liu R, Zhang Z, Yang H, Zhou K, Geng M, Zhou W, Zhang M, Huang X, Li Y.. (2019) Design, synthesis, and biological evaluation of a new class of histone acetyltransferase p300 inhibitors., 180 [PMID:31306905 ] [10.1016/j.ejmech.2019.07.026 ]