The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Cyclobutyl-4-cyclopentyl-4-(1-((1-(4-(pyridin-4-ylsulfonyl)phenyl)azetidin-3-yl)methyl)piperidin-4-yl)-1,2,3,4-tetrahydroisoquinoline ID: ALA4522767
PubChem CID: 132104363
Max Phase: Preclinical
Molecular Formula: C38H48N4O2S
Molecular Weight: 624.90
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccncc1)c1ccc(N2CC(CN3CCC(C4(C5CCCC5)CN(C5CCC5)Cc5ccccc54)CC3)C2)cc1
Standard InChI: InChI=1S/C38H48N4O2S/c43-45(44,36-16-20-39-21-17-36)35-14-12-34(13-15-35)41-25-29(26-41)24-40-22-18-32(19-23-40)38(31-7-2-3-8-31)28-42(33-9-5-10-33)27-30-6-1-4-11-37(30)38/h1,4,6,11-17,20-21,29,31-33H,2-3,5,7-10,18-19,22-28H2
Standard InChI Key: AZMLEISFRDLXOA-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 52 0 0 0 0 0 0 0 0999 V2000
2.7582 -15.8077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3457 -15.2244 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5468 -15.0073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5482 -19.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5470 -20.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2618 -20.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9783 -20.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2600 -18.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9745 -19.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6825 -18.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6823 -18.1740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9678 -17.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2536 -18.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8330 -17.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1683 -16.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5457 -16.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8256 -16.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0033 -17.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4497 -18.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8673 -17.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0663 -17.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8412 -18.7992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4235 -19.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2310 -19.1869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0421 -19.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4653 -18.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4778 -17.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6528 -17.5826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6436 -18.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0761 -16.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3021 -16.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7261 -15.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9259 -15.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7049 -16.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2825 -17.2002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5697 -14.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3678 -14.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5918 -13.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0165 -12.8463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2140 -13.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9936 -13.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3961 -17.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1902 -17.9725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4024 -17.1754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6051 -16.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 4 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
13 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 26 1 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 2 1 0
2 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
11 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 624.90Molecular Weight (Monoisotopic): 624.3498AlogP: 6.56#Rotatable Bonds: 8Polar Surface Area: 56.75Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.80CX LogP: 6.27CX LogD: 3.40Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.28Np Likeness Score: -0.62
References 1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S.. (2019) Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction., 62 (13): [PMID:31244110 ] [10.1021/acs.jmedchem.9b00021 ]