The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cryptomerin B ID: ALA4522982
Cas Number: 22012-98-2
PubChem CID: 5316145
Max Phase: Preclinical
Molecular Formula: C32H22O10
Molecular Weight: 566.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(=O)c3c(O)c(Oc4ccc(-c5cc(=O)c6c(O)cc(O)cc6o5)cc4)c(OC)cc3o2)cc1
Standard InChI: InChI=1S/C32H22O10/c1-38-19-7-3-16(4-8-19)25-14-23(36)30-27(42-25)15-28(39-2)32(31(30)37)40-20-9-5-17(6-10-20)24-13-22(35)29-21(34)11-18(33)12-26(29)41-24/h3-15,33-34,37H,1-2H3
Standard InChI Key: XLXOFHHXAZAIHM-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
42.0744 -8.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3649 -8.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3644 -9.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0725 -10.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7827 -9.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7797 -8.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6589 -10.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9512 -9.6961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9550 -11.3305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6596 -10.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2426 -10.9216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2441 -10.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5391 -9.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8321 -10.1053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8346 -10.9246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5402 -11.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5424 -12.1457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9573 -12.1477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.4864 -8.4693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.4844 -7.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1932 -7.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7732 -6.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7783 -7.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4822 -6.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1898 -6.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8932 -6.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8952 -5.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1876 -4.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4780 -5.2049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.9016 -7.6510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.6004 -6.4307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.1889 -3.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8986 -3.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8995 -2.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1915 -2.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4812 -2.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4837 -3.5769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1239 -9.6976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.0730 -7.6620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3630 -7.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1910 -1.5386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.8984 -1.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 12 1 0
11 9 1 0
9 10 1 0
10 7 2 0
3 7 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 11 2 0
16 17 1 0
9 18 2 0
6 19 1 0
19 20 1 0
20 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 20 1 0
24 25 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
21 30 1 0
26 31 2 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
28 32 1 0
14 38 1 0
23 39 1 0
39 40 1 0
35 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.52Molecular Weight (Monoisotopic): 566.1213AlogP: 6.16#Rotatable Bonds: 6Polar Surface Area: 148.80Molecular Species: ACIDHBA: 10HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.21CX Basic pKa: ┄CX LogP: 5.54CX LogD: 3.65Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.21Np Likeness Score: 0.83
References 1. Sirimangkalakitti N, Juliawaty LD, Hakim EH, Waliana I, Saito N, Koyama K, Kinoshita K.. (2019) Naturally occurring biflavonoids with amyloid β aggregation inhibitory activity for development of anti-Alzheimer agents., 29 (15): [PMID:31138471 ] [10.1016/j.bmcl.2019.05.020 ]