2-(4-(aminomethyl)-4-methylpiperidin-1-yl)-5-((2-(trifluoromethyl)pyridin-3-yl)thio)pyrimidin-4(3H)-one

ID: ALA4523033

PubChem CID: 124150360

Max Phase: Preclinical

Molecular Formula: C17H20F3N5OS

Molecular Weight: 399.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(CN)CCN(c2ncc(Sc3cccnc3C(F)(F)F)c(=O)[nH]2)CC1

Standard InChI:  InChI=1S/C17H20F3N5OS/c1-16(10-21)4-7-25(8-5-16)15-23-9-12(14(26)24-15)27-11-3-2-6-22-13(11)17(18,19)20/h2-3,6,9H,4-5,7-8,10,21H2,1H3,(H,23,24,26)

Standard InChI Key:  OWJVXNYVTUXGIY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   18.2011  -12.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3839  -12.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7925  -13.3288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0224  -10.5946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0213  -11.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7293  -11.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4390  -11.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4361  -10.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7275  -10.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1423  -10.1797    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.8515  -10.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8520  -11.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5572  -11.8059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2658  -11.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2647  -10.5800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5550  -10.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9723  -11.8036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9703  -12.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6739  -13.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3860  -11.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6779  -11.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1447  -11.8093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3839  -14.0365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7251   -9.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4316   -8.9578    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.0162   -8.9620    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.7172   -8.5475    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 16  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 17 18  1  0
 17 21  1  0
 18 19  1  0
 19  2  1  0
  2 20  1  0
 20 21  1  0
 14 17  1  0
 12 22  2  0
  3 23  1  0
  9 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4523033

    ---

Associated Targets(Human)

KYSE-520 cell line (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN11 Tchem Protein-tyrosine phosphatase 2C (2297 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.44Molecular Weight (Monoisotopic): 399.1341AlogP: 2.90#Rotatable Bonds: 4
Polar Surface Area: 87.90Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.97CX Basic pKa: 9.62CX LogP: 1.01CX LogD: 0.40
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.82Np Likeness Score: -0.92

References

1. Sarver P, Acker M, Bagdanoff JT, Chen Z, Chen YN, Chan H, Firestone B, Fodor M, Fortanet J, Hao H, Hentemann M, Kato M, Koenig R, LaBonte LR, Liu G, Liu S, Liu C, McNeill E, Mohseni M, Sendzik M, Stams T, Spence S, Tamez V, Tichkule R, Towler C, Wang H, Wang P, Williams SL, Yu B, LaMarche MJ..  (2019)  6-Amino-3-methylpyrimidinones as Potent, Selective, and Orally Efficacious SHP2 Inhibitors.,  62  (4): [PMID:30688459] [10.1021/acs.jmedchem.8b01726]

Source