The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-6,9-Dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diyl diacetate ID: ALA4523054
PubChem CID: 146025820
Max Phase: Preclinical
Molecular Formula: C22H23NO4
Molecular Weight: 365.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Oc1c(C)cc2c(c1OC(C)=O)-c1cccc3c1[C@@H](C2)N(C)CC3
Standard InChI: InChI=1S/C22H23NO4/c1-12-10-16-11-18-19-15(8-9-23(18)4)6-5-7-17(19)20(16)22(27-14(3)25)21(12)26-13(2)24/h5-7,10,18H,8-9,11H2,1-4H3/t18-/m1/s1
Standard InChI Key: IYCVIMNLFPKSNJ-GOSISDBHSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
6.2523 -6.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9617 -6.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9617 -5.2705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2523 -4.8536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2475 -4.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5429 -6.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5454 -5.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8375 -4.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1266 -5.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1280 -6.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8365 -6.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8256 -4.0435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5359 -3.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5330 -2.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8206 -2.4049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1095 -2.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1159 -3.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6710 -4.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3984 -2.4213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4114 -4.0556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9544 -4.4409 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.3916 -1.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6805 -1.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0959 -1.1896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7005 -3.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9961 -4.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6940 -2.8354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8163 -1.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
7 4 1 0
4 5 1 0
5 13 1 0
12 8 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
3 18 1 0
16 19 1 0
17 20 1 0
4 21 1 6
19 22 1 0
22 23 1 0
22 24 2 0
20 25 1 0
25 26 1 0
25 27 2 0
15 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 365.43Molecular Weight (Monoisotopic): 365.1627AlogP: 3.60#Rotatable Bonds: 2Polar Surface Area: 55.84Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.56CX LogP: 3.43CX LogD: 3.04Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.60Np Likeness Score: 1.04
References 1. Park H, Urs AN, Zimmerman J, Liu C, Wang Q, Urs NM.. (2020) Structure-Functional-Selectivity Relationship Studies of Novel Apomorphine Analogs to Develop D1R/D2R Biased Ligands., 11 (3): [PMID:32184974 ] [10.1021/acsmedchemlett.9b00575 ]