The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(2-((2-methoxy-4-(piperazin-1-yl)phenyl)amino)pyridin-4-yl)-N-(4-(trifluoromethoxy)benzyl)piperidine-3-carboxamide ID: ALA4523063
PubChem CID: 146014467
Max Phase: Preclinical
Molecular Formula: C30H35F3N6O3
Molecular Weight: 584.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCNCC2)ccc1Nc1cc(N2CCC[C@H](C(=O)NCc3ccc(OC(F)(F)F)cc3)C2)ccn1
Standard InChI: InChI=1S/C30H35F3N6O3/c1-41-27-17-23(38-15-12-34-13-16-38)6-9-26(27)37-28-18-24(10-11-35-28)39-14-2-3-22(20-39)29(40)36-19-21-4-7-25(8-5-21)42-30(31,32)33/h4-11,17-18,22,34H,2-3,12-16,19-20H2,1H3,(H,35,37)(H,36,40)/t22-/m0/s1
Standard InChI Key: JQWJRFOFKDLCQB-QFIPXVFZSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
25.4031 -11.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4031 -12.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1125 -12.9347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8219 -12.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8219 -11.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1125 -11.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1121 -13.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3986 -14.1632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3983 -14.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1106 -15.3973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8248 -14.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8217 -14.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5349 -11.2983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2456 -11.7090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5373 -10.4770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9586 -11.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6692 -11.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6655 -12.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3712 -12.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0852 -12.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0850 -11.7139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3746 -11.3070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6862 -15.3961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9780 -14.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9784 -14.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2709 -13.7652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5628 -14.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5665 -14.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2745 -15.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7926 -12.9485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7921 -13.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4995 -14.1748 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.0841 -14.1739 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.7879 -14.5815 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.8540 -13.7681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8541 -12.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1494 -12.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4404 -12.9546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4406 -13.7728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1499 -14.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2791 -16.2173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5736 -16.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 6
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
20 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
27 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
29 41 1 0
41 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.64Molecular Weight (Monoisotopic): 584.2723AlogP: 4.67#Rotatable Bonds: 9Polar Surface Area: 90.99Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.48CX LogP: 5.11CX LogD: 2.24Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.33Np Likeness Score: -1.42
References 1. Liu S, Jiang Y, Yan R, Li Z, Wan S, Zhang T, Wu X, Hou J, Zhu Z, Tian Y, Zhang J.. (2019) Design, synthesis and biological evaluations of 2-amino-4-(1-piperidine) pyridine derivatives as novel anti crizotinib-resistant ALK/ROS1 dual inhibitors., 179 [PMID:31260890 ] [10.1016/j.ejmech.2019.06.043 ]