The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-Methoxy-6-(3,4,5-trimethoxybenzylidene)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-one ID: ALA4523070
PubChem CID: 155543858
Max Phase: Preclinical
Molecular Formula: C22H24O5
Molecular Weight: 368.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)CCC/C(=C\c1cc(OC)c(OC)c(OC)c1)C2=O
Standard InChI: InChI=1S/C22H24O5/c1-24-17-8-9-18-15(13-17)6-5-7-16(21(18)23)10-14-11-19(25-2)22(27-4)20(12-14)26-3/h8-13H,5-7H2,1-4H3/b16-10+
Standard InChI Key: UQRIAFPBMWYSFN-MHWRWJLKSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
2.9784 -19.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9773 -19.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6853 -20.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6836 -18.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3914 -19.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3922 -19.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0382 -18.6247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0396 -20.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8435 -18.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8458 -20.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2007 -19.5468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8529 -17.8288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2693 -20.3737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5619 -19.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3513 -18.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1597 -18.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4580 -19.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2655 -19.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7742 -18.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4696 -17.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6629 -17.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9752 -17.1155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7840 -17.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5828 -18.6390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8844 -19.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5658 -19.9211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0576 -20.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 8 1 0
7 9 1 0
8 10 1 0
9 11 1 0
10 11 1 0
7 12 2 0
2 13 1 0
13 14 1 0
9 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
18 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 368.43Molecular Weight (Monoisotopic): 368.1624AlogP: 4.32#Rotatable Bonds: 5Polar Surface Area: 53.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.15CX LogD: 4.15Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.58Np Likeness Score: -0.05
References 1. Maguire CJ, Carlson GJ, Ford JW, Strecker TE, Hamel E, Trawick ML, Pinney KG.. (2019) Synthesis and biological evaluation of structurally diverse α-conformationally restricted chalcones and related analogues., 10 (8): [PMID:31534659 ] [10.1039/C9MD00127A ]