monovalinoyl curcumin

ID: ALA452316

PubChem CID: 25111343

Max Phase: Preclinical

Molecular Formula: C26H29NO7

Molecular Weight: 467.52

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Monovalinoyl Curcumin | monovalinoyl curcumin|CHEMBL452316

Canonical SMILES:  COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)[C@@H](N)C(C)C)c(OC)c2)ccc1O

Standard InChI:  InChI=1S/C26H29NO7/c1-16(2)25(27)26(31)34-22-12-8-18(14-24(22)33-4)6-10-20(29)15-19(28)9-5-17-7-11-21(30)23(13-17)32-3/h5-14,16,25,30H,15,27H2,1-4H3/b9-5+,10-6+/t25-/m0/s1

Standard InChI Key:  VFKLDHRMILHGAN-RFFAATPASA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
    2.1501  -23.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1484  -23.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8648  -24.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5794  -23.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5794  -23.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8621  -22.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2928  -22.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0069  -23.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7204  -22.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4344  -23.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7157  -21.8526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1480  -22.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8662  -23.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1473  -21.8486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5797  -22.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2937  -23.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2945  -23.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0113  -24.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7221  -23.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7177  -23.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0039  -22.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4289  -22.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4412  -24.3015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4342  -22.6915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4339  -21.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4362  -24.3398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4240  -21.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1540  -23.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8687  -24.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1475  -23.0627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5815  -23.8808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8709  -25.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1625  -25.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5900  -25.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
 21 16  1  0
  2  3  1  0
 20 22  1  0
  9 11  2  0
 19 23  1  0
  5  6  2  0
  1 24  1  0
 10 12  1  0
 24 25  1  0
  6  1  1  0
  2 26  1  0
 12 13  1  0
 22 27  1  0
  1  2  2  0
 23 28  1  0
 12 14  2  0
 28 29  1  0
  5  7  1  0
 28 30  2  0
 13 15  2  0
 29 31  1  0
  3  4  2  0
 29 32  1  1
 15 16  1  0
 32 33  1  0
  7  8  2  0
 32 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA452316

   MONOVALINOYL CURCUMIN

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 467.52

Molecular Weight (Monoisotopic): 467.1944

AlogP: 3.55

#Rotatable Bonds: 11

Polar Surface Area: 125.15

Molecular Species: NEUTRAL

HBA: 8

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 3

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 9.28

CX Basic pKa: 7.31

CX LogP: 4.57

CX LogD: 4.30

Aromatic Rings: 2

Heavy Atoms: 34

QED Weighted: 0.22

Np Likeness Score: 0.68

References

1. Dubey SK, Sharma AK, Narain U, Misra K, Pati U..  (2008)  Design, synthesis and characterization of some bioactive conjugates of curcumin with glycine, glutamic acid, valine and demethylenated piperic acid and study of their antimicrobial and antiproliferative properties.,  43  (9): [PMID:18201805] [10.1016/j.ejmech.2007.11.027]

Source

Source(1):

• Scientific Literature