18-sec-Butyl-5-isobutyl-15-isopropyl-12,13,16-trimethyl-dodecahydro-6-oxa-3a,10,13,16,19-pentaaza-cyclopentacyclononadecene-4,7,11,14,17,20-hexaone

ID: ALA4524056

Cas Number: 2503-26-6

PubChem CID: 11124817

Product Number: D647928, Order Now?

Max Phase: Preclinical

Molecular Formula: C30H51N5O7

Molecular Weight: 593.77

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC[C@H](C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(C)C)OC(=O)CCNC(=O)[C@H](C)N(C)C(=O)[C@H](C(C)C)N(C)C1=O

Standard InChI:  InChI=1S/C30H51N5O7/c1-10-19(6)24-29(40)34(9)25(18(4)5)30(41)33(8)20(7)26(37)31-14-13-23(36)42-22(16-17(2)3)28(39)35-15-11-12-21(35)27(38)32-24/h17-22,24-25H,10-16H2,1-9H3,(H,31,37)(H,32,38)/t19-,20-,21-,22+,24-,25-/m0/s1

Standard InChI Key:  GNBHVMBELHWUIF-VTSYCQLTSA-N

Molfile:  

     RDKit          2D

 44 45  0  0  0  0  0  0  0  0999 V2000
   19.4796   -7.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4501   -8.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9047   -8.7121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1299   -9.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3248   -9.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9085   -7.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6185   -6.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3374   -7.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0474   -6.7400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9351   -9.6503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6451   -9.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7662   -7.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7751   -7.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7928   -9.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3639   -9.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4939   -8.3746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5028   -9.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2901   -9.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7678   -8.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2758   -8.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0651   -8.3899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3462   -7.9851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8016  -10.4446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6362   -8.4052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9618  -10.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7908  -10.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8121   -9.9940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0833   -8.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6002   -7.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7698   -6.7705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4762   -6.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4674   -5.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3728  -10.4599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0916  -10.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6628  -10.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1005  -11.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0306  -10.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4484  -10.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1774   -5.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7485   -5.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1897   -6.7707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0739   -9.2149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7839   -8.7947    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.0828  -10.0398    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  5  1  0
  5  3  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 12  1  0
  4 10  1  0
 10 11  1  0
 12 13  1  0
 13 16  1  0
 17 14  1  0
 11 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 13 21  2  0
  8 22  2  0
 14 23  2  0
 11 24  2  0
 10 25  1  0
  4 26  1  6
  5 27  2  0
  3 28  1  0
  2 29  1  6
  1 30  2  0
 12 31  1  6
 31 32  1  0
 15 33  1  0
 33 34  1  0
 33 35  1  6
 34 36  1  0
 26 37  1  0
 26 38  1  0
 32 39  1  0
 32 40  1  0
 41  6  1  0
 41  1  1  0
 14 42  1  0
 15 42  1  0
 17 43  1  6
 15 44  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA4524056

   Destruxin B

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 593.77

Molecular Weight (Monoisotopic): 593.3788

AlogP: 1.32

#Rotatable Bonds: 5

Polar Surface Area: 145.43

Molecular Species: NEUTRAL

HBA: 7

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 12

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.56

CX Basic pKa: ┄

CX LogP: 1.37

CX LogD: 1.37

Aromatic Rings: ┄

Heavy Atoms: 42

QED Weighted: 0.46

Np Likeness Score: 1.72

References

1. Ahuja D, Geiger A, Ramanjulu JM, Vera MD, SirDeshpande B, Pfizenmayer A, Abazeed M, Krosky DJ, Beidler D, Joullié MM, Toogood PL..  (2000)  Inhibition of protein synthesis by didemnins: cell potency and SAR.,  43  (22): [PMID:11063617] [10.1021/jm000168v]

2. Cai P, Smith D, Katz B, Pearce C, Venables D, Houck D..  (1998)  Destruxin-A4 chlorohydrin, a novel destruxin from fungus OS-F68576: isolation, structure determination, and biological activity as an inducer of erythropoietin.,  61  (2): [PMID:9514014] [10.1021/np970475c]

3. Chen H, Yeh SF, Ong GT, Wu SH, Sun CM, Chou CK..  (1995)  The novel desmethyldestruxin B2, from Metarhizium anisopliae, that suppresses hepatitis B virus surface antigen production in human hepatoma cells.,  58  (4): [PMID:7623030] [10.1021/np50118a007]

Source

Source(1):

• Scientific Literature