3-(4,5-dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one

ID: ALA4524154

PubChem CID: 155520007

Max Phase: Preclinical

Molecular Formula: C16H14O5

Molecular Weight: 286.28

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c(O)cc1/C=C/C(=O)c1ccc(O)cc1

Standard InChI:  InChI=1S/C16H14O5/c1-21-16-9-15(20)14(19)8-11(16)4-7-13(18)10-2-5-12(17)6-3-10/h2-9,17,19-20H,1H3/b7-4+

Standard InChI Key:  IJVAZMFCJQYJSG-QPJJXVBHSA-N

Molfile:  

 
     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
   16.5075   -3.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5064   -4.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2144   -5.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9241   -4.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9212   -3.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2126   -3.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6274   -3.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3366   -3.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6243   -2.6434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0428   -3.4552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7520   -3.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7520   -4.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4604   -5.0831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1676   -4.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1619   -3.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4529   -3.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7983   -5.1030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4461   -2.6310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8774   -5.0767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4631   -5.9003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1505   -2.2166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  2 17  1  0
 16 18  1  0
 14 19  1  0
 13 20  1  0
 18 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524154

    ---

Associated Targets(Human)

APP Tclin Amyloid-beta A4 protein (8510 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 286.28Molecular Weight (Monoisotopic): 286.0841AlogP: 2.71#Rotatable Bonds: 4
Polar Surface Area: 86.99Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.85CX Basic pKa: CX LogP: 2.82CX LogD: 2.69
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.46Np Likeness Score: 0.59

References

1. Bai P, Wang K, Zhang P, Shi J, Cheng X, Zhang Q, Zheng C, Cheng Y, Yang J, Lu X, Sang Z..  (2019)  Development of chalcone-O-alkylamine derivatives as multifunctional agents against Alzheimer's disease.,  183  [PMID:31581002] [10.1016/j.ejmech.2019.111737]

Source