The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl 4-[2-bromo-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate ID: ALA4524234
PubChem CID: 155520101
Max Phase: Preclinical
Molecular Formula: C24H23BrFN3O4S
Molecular Weight: 548.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1c(-c2ccc(F)cc2)nc2sc(Br)cn12
Standard InChI: InChI=1S/C24H23BrFN3O4S/c1-5-32-22(30)17-12(3)27-13(4)18(23(31)33-6-2)19(17)21-20(14-7-9-15(26)10-8-14)28-24-29(21)11-16(25)34-24/h7-11,19,27H,5-6H2,1-4H3
Standard InChI Key: GROKVYHUXHIFAK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
42.0930 -20.8551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.8390 -21.6319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5022 -22.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8295 -23.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2121 -23.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5187 -23.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8295 -24.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2121 -24.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5187 -24.8872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1278 -23.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9137 -23.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1196 -22.4728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.9137 -22.4728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4345 -23.6862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.6071 -23.6862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.1278 -24.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9137 -24.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7287 -23.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3046 -23.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9102 -20.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1561 -21.6301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.9695 -21.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2264 -20.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5717 -20.3813 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.0241 -23.6998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0113 -23.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0205 -21.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6141 -20.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7964 -20.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3854 -21.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7981 -22.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6144 -22.3362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5682 -21.6265 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
45.0054 -20.6169 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
20 1 2 0
1 2 1 0
2 3 2 0
3 21 1 0
5 6 1 0
6 4 1 0
7 4 2 0
8 9 1 0
9 7 1 0
3 6 1 0
10 4 1 0
11 5 1 0
12 10 2 0
13 11 2 0
14 10 1 0
15 11 1 0
16 7 1 0
17 8 1 0
18 14 1 0
19 15 1 0
8 5 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
18 25 1 0
19 26 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
23 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.43Molecular Weight (Monoisotopic): 547.0577AlogP: 5.33#Rotatable Bonds: 6Polar Surface Area: 81.93Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.03CX LogP: 4.36CX LogD: 4.36Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.12
References 1. Leoni A, Frosini M, Locatelli A, Micucci M, Carotenuto C, Durante M, Cosconati S, Budriesi R.. (2019) 4-Imidazo[2,1-b]thiazole-1,4-DHPs and neuroprotection: preliminary study in hits searching., 169 [PMID:30861492 ] [10.1016/j.ejmech.2019.02.075 ]