The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1S)-1,5-anhydro-1-{2-hydroxy-5-[(4-{(1E)-4-[(1-hydroxy-2-methylpropan-2-yl)amino]-3,3-dimethyl-4-oxobut-1-en-1-yl}phenyl)methyl]-4-methylphenyl}-D-glucitol ID: ALA4524341
PubChem CID: 155520018
Max Phase: Preclinical
Molecular Formula: C30H41NO8
Molecular Weight: 543.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(/C=C/C(C)(C)C(=O)NC(C)(C)CO)cc1
Standard InChI: InChI=1S/C30H41NO8/c1-17-12-22(34)21(27-26(37)25(36)24(35)23(15-32)39-27)14-20(17)13-19-8-6-18(7-9-19)10-11-29(2,3)28(38)31-30(4,5)16-33/h6-12,14,23-27,32-37H,13,15-16H2,1-5H3,(H,31,38)/b11-10+/t23-,24-,25+,26-,27+/m1/s1
Standard InChI Key: HXRWAXMICBICQK-IWRPRXAJSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
32.3580 -14.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9496 -14.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5367 -14.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3871 -12.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8039 -13.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2162 -12.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3816 -14.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3804 -14.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0953 -15.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8118 -14.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8088 -14.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0935 -13.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6692 -15.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9553 -14.8466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2426 -15.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2377 -16.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9517 -16.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6706 -16.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5214 -16.4895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3843 -16.4993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9482 -17.3205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5301 -14.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5338 -14.0142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5268 -15.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2407 -14.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9524 -15.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6657 -14.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6648 -14.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9447 -13.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2343 -14.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3782 -13.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0937 -14.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5228 -14.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2360 -13.5996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5251 -14.8392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6649 -13.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3806 -14.0059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6671 -13.6125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5218 -13.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 8 1 1
16 19 1 6
18 20 1 6
17 21 1 1
15 22 1 1
22 23 1 0
10 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 2 0
32 5 1 0
5 33 1 0
33 34 1 0
33 35 2 0
34 2 1 0
2 36 1 0
36 37 1 0
7 38 1 0
11 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.66Molecular Weight (Monoisotopic): 543.2832AlogP: 1.73#Rotatable Bonds: 9Polar Surface Area: 159.71Molecular Species: NEUTRALHBA: 8HBD: 7#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.30CX Basic pKa: ┄CX LogP: 2.29CX LogD: 2.28Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: 0.98
References 1. Kuroda S, Kobashi Y, Oi T, Kawabe K, Shiozawa F, Okumura-Kitajima L, Sugisaki-Kitano M, Io F, Yamamoto K, Kakinuma H.. (2019) Discovery of potent, low-absorbable sodium-dependent glucose cotransporter 1 (SGLT1) inhibitor SGL5213 for type 2 diabetes treatment., 27 (2): [PMID:30579799 ] [10.1016/j.bmc.2018.12.015 ]