(E)-3-(2-Chlorophenyl)-1-(4-(3-morpholinopropoxy)phenyl)prop-2-en-1-one

ID: ALA4524361

PubChem CID: 72189661

Max Phase: Preclinical

Molecular Formula: C22H24ClNO3

Molecular Weight: 385.89

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccccc1Cl)c1ccc(OCCCN2CCOCC2)cc1

Standard InChI:  InChI=1S/C22H24ClNO3/c23-21-5-2-1-4-18(21)8-11-22(25)19-6-9-20(10-7-19)27-15-3-12-24-13-16-26-17-14-24/h1-2,4-11H,3,12-17H2/b11-8+

Standard InChI Key:  DKJZBZCBDVEXLS-DHZHZOJOSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   22.6489  -22.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6477  -23.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3626  -24.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0790  -23.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0761  -22.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3608  -22.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7891  -22.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5051  -22.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2180  -22.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9340  -22.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9340  -23.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6491  -24.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3630  -23.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3572  -22.8281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6415  -22.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7860  -21.6097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9330  -24.0928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2188  -23.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5041  -24.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7899  -23.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0751  -24.0905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3643  -23.6759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6516  -24.0842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6467  -24.9096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3607  -25.3249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0796  -24.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6347  -21.5972    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 16  2  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 26  1  0
 15 27  1  0
M  END

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.89Molecular Weight (Monoisotopic): 385.1445AlogP: 4.34#Rotatable Bonds: 8
Polar Surface Area: 38.77Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.31CX LogP: 4.20CX LogD: 4.16
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.38Np Likeness Score: -1.31

References

1. Kim HJ, Jang BK, Park JH, Choi JW, Park SJ, Byeon SR, Pae AN, Lee YS, Cheong E, Park KD..  (2020)  A novel chalcone derivative as Nrf2 activator attenuates learning and memory impairment in a scopolamine-induced mouse model.,  185  [PMID:31670201] [10.1016/j.ejmech.2019.111777]

Source