2-(1-(3-chlorophenyl)-2-hydroxyethyl)-6-(2-((tetrahydrofuran-3-yl)amino)pyrimidin-4-yl)isoindolin-1-one

ID: ALA4524371

PubChem CID: 146634277

Max Phase: Preclinical

Molecular Formula: C24H23ClN4O3

Molecular Weight: 450.93

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1c2cc(-c3ccnc(NC4CCOC4)n3)ccc2CN1C(CO)c1cccc(Cl)c1

Standard InChI:  InChI=1S/C24H23ClN4O3/c25-18-3-1-2-16(10-18)22(13-30)29-12-17-5-4-15(11-20(17)23(29)31)21-6-8-26-24(28-21)27-19-7-9-32-14-19/h1-6,8,10-11,19,22,30H,7,9,12-14H2,(H,26,27,28)

Standard InChI Key:  KZAQNEBPJPEBHM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   15.5417   -1.3537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5406   -2.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2486   -2.5822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9583   -2.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9555   -1.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2468   -0.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6631   -2.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6631   -3.3978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3706   -3.8052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3666   -2.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8325   -2.5813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0747   -2.5740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0817   -3.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8623   -3.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3378   -2.9725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8510   -2.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0969   -1.5352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1550   -2.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5697   -3.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5575   -2.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3749   -2.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7774   -1.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3626   -0.8355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5413   -0.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1426   -1.5561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3868   -3.6627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8319   -3.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1714   -3.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4233   -4.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2405   -4.6524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4935   -3.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5945   -1.5341    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 13  2  0
 12 10  2  0
 10  7  1  0
  4  7  1  0
  2 11  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 16 17  2  0
 15 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  0
 11 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
 22 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524371

    ---

Associated Targets(Human)

MAPK1 Tchem MAP kinase ERK2 (25055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.93Molecular Weight (Monoisotopic): 450.1459AlogP: 3.69#Rotatable Bonds: 6
Polar Surface Area: 87.58Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.67CX Basic pKa: 3.81CX LogP: 2.88CX LogD: 2.88
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: -0.76

References

1. Ji D, Zhang L, Zhu Q, Bai Y, Wu Y, Xu Y..  (2019)  Discovery of potent, orally bioavailable ERK1/2 inhibitors with isoindolin-1-one structure by structure-based drug design.,  164  [PMID:30605831] [10.1016/j.ejmech.2018.12.040]

Source