The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Hydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-en-1-yl)-9-(4-(pyrrolidin-1-yl)butoxy)-2H,6H-pyrano[3,2-b]xanthen-6-one ID: ALA4524406
PubChem CID: 155520087
Max Phase: Preclinical
Molecular Formula: C32H39NO6
Molecular Weight: 533.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(OCCCCN2CCCC2)cc2oc3cc4c(c(O)c3c(=O)c2c1CC=C(C)C)C=CC(C)(C)O4
Standard InChI: InChI=1S/C32H39NO6/c1-20(2)10-11-22-27-24(19-26(31(22)36-5)37-17-9-8-16-33-14-6-7-15-33)38-25-18-23-21(12-13-32(3,4)39-23)29(34)28(25)30(27)35/h10,12-13,18-19,34H,6-9,11,14-17H2,1-5H3
Standard InChI Key: AVENQSVCQAKYLO-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
55.5618 -28.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
56.2763 -28.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
56.9908 -28.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
57.7053 -28.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
57.7053 -29.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
56.9908 -29.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
56.2763 -29.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
55.5618 -29.8370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
54.8474 -29.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
54.1329 -29.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
53.4184 -29.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
53.4184 -28.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
54.1329 -28.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
54.8474 -28.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
58.4197 -28.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
59.1342 -28.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
59.1342 -29.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
58.4197 -29.8370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
55.5618 -27.3620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
52.7040 -29.8370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
51.9895 -29.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.2750 -29.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
50.5606 -29.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.8461 -29.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.1316 -29.4245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
49.0454 -28.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.2384 -28.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.8259 -29.1470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.3779 -29.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
54.1329 -27.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
53.4184 -26.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
53.4184 -26.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
54.1329 -25.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.7040 -25.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
59.4164 -30.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
59.9467 -29.2812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.7040 -28.1870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
51.9895 -28.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
56.9908 -27.3620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
1 14 1 0
15 16 2 0
16 17 1 0
17 18 1 0
4 15 1 0
5 18 1 0
1 19 2 0
21 22 1 0
22 23 1 0
23 24 1 0
20 21 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
25 29 1 0
24 25 1 0
11 20 1 0
30 31 1 0
31 32 2 0
32 33 1 0
32 34 1 0
13 30 1 0
17 35 1 0
17 36 1 0
37 38 1 0
12 37 1 0
3 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.67Molecular Weight (Monoisotopic): 533.2777AlogP: 6.61#Rotatable Bonds: 9Polar Surface Area: 81.37Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.23CX Basic pKa: 9.87CX LogP: 5.38CX LogD: 4.62Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: 1.69
References 1. Liang J, Huang YY, Zhou Q, Gao Y, Li Z, Wu D, Yu S, Guo L, Chen Z, Huang L, Liang SH, He X, Wu R, Luo HB.. (2020) Discovery and Optimization of α-Mangostin Derivatives as Novel PDE4 Inhibitors for the Treatment of Vascular Dementia., 63 (6): [PMID:32115956 ] [10.1021/acs.jmedchem.0c00060 ]