(S)-3-(4-(3-(4-(2-Hydroxy-2-methylpropoxy)-3-methylphenyl)pentan-3-yl)-2-methylphenoxy)propane-1,2-diol

ID: ALA4524433

PubChem CID: 155520127

Max Phase: Preclinical

Molecular Formula: C26H38O5

Molecular Weight: 430.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(CC)(c1ccc(OC[C@@H](O)CO)c(C)c1)c1ccc(OCC(C)(C)O)c(C)c1

Standard InChI:  InChI=1S/C26H38O5/c1-7-26(8-2,20-9-11-23(18(3)13-20)30-16-22(28)15-27)21-10-12-24(19(4)14-21)31-17-25(5,6)29/h9-14,22,27-29H,7-8,15-17H2,1-6H3/t22-/m0/s1

Standard InChI Key:  FOVIJFDLUANMTH-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   14.0513  -16.5182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6429  -17.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4679  -17.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3570  -15.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0472  -15.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9191  -14.3295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9182  -14.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7140  -15.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2159  -16.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2148  -16.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9296  -17.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6462  -16.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6433  -16.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9279  -15.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0724  -16.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0721  -16.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7873  -17.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5014  -16.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4956  -16.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7798  -15.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9294  -18.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7901  -18.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2180  -17.2435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4999  -17.2660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7857  -16.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0709  -17.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3566  -16.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417  -17.2636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0702  -18.0898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9304  -16.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6512  -18.0614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 13  4  1  0
  4 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 11 21  1  0
 17 22  1  0
 18 23  1  0
 10 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  1  1
 23 30  1  0
 30  2  1  0
  2 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524433

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.59Molecular Weight (Monoisotopic): 430.2719AlogP: 4.29#Rotatable Bonds: 11
Polar Surface Area: 79.15Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.58CX Basic pKa: CX LogP: 4.94CX LogD: 4.94
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: 0.05

References

1. Misawa T, Tsuji G, Takahashi T, Ochiai E, Takagi KI, Horie K, Kakuda S, Takimoto-Kamimura M, Kurihara M, Demizu Y..  (2018)  Structural development of non-secosteroidal vitamin D receptor (VDR) ligands without any asymmetric carbon.,  26  (23-24): [PMID:30446437] [10.1016/j.bmc.2018.11.008]

Source