The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(4-(3-(4-(2-Hydroxy-2-methylpropoxy)-3-methylphenyl)pentan-3-yl)-2-methylphenoxy)propane-1,2-diol ID: ALA4524433
PubChem CID: 155520127
Max Phase: Preclinical
Molecular Formula: C26H38O5
Molecular Weight: 430.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(CC)(c1ccc(OC[C@@H](O)CO)c(C)c1)c1ccc(OCC(C)(C)O)c(C)c1
Standard InChI: InChI=1S/C26H38O5/c1-7-26(8-2,20-9-11-23(18(3)13-20)30-16-22(28)15-27)21-10-12-24(19(4)14-21)31-17-25(5,6)29/h9-14,22,27-29H,7-8,15-17H2,1-6H3/t22-/m0/s1
Standard InChI Key: FOVIJFDLUANMTH-QFIPXVFZSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
14.0513 -16.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6429 -17.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4679 -17.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3570 -15.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0472 -15.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9191 -14.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9182 -14.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7140 -15.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2159 -16.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2148 -16.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9296 -17.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6462 -16.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6433 -16.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9279 -15.6137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0724 -16.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0721 -16.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7873 -17.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5014 -16.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4956 -16.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7798 -15.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9294 -18.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7901 -18.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2180 -17.2435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4999 -17.2660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7857 -16.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0709 -17.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3566 -16.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -17.2636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0702 -18.0898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9304 -16.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6512 -18.0614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
13 4 1 0
4 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
11 21 1 0
17 22 1 0
18 23 1 0
10 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 1
23 30 1 0
30 2 1 0
2 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.59Molecular Weight (Monoisotopic): 430.2719AlogP: 4.29#Rotatable Bonds: 11Polar Surface Area: 79.15Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.58CX Basic pKa: ┄CX LogP: 4.94CX LogD: 4.94Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: 0.05
References 1. Misawa T, Tsuji G, Takahashi T, Ochiai E, Takagi KI, Horie K, Kakuda S, Takimoto-Kamimura M, Kurihara M, Demizu Y.. (2018) Structural development of non-secosteroidal vitamin D receptor (VDR) ligands without any asymmetric carbon., 26 (23-24): [PMID:30446437 ] [10.1016/j.bmc.2018.11.008 ]