The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 2-fluoro-4-(1-(1-(7-fluoroquinolin-6-yl)propyl)-1H-imidazo[4,5-b]pyrazin-6-yl)benzoate ID: ALA4524484
PubChem CID: 155520114
Max Phase: Preclinical
Molecular Formula: C25H19F2N5O2
Molecular Weight: 459.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(c1cc2cccnc2cc1F)n1cnc2ncc(-c3ccc(C(=O)OC)c(F)c3)nc21
Standard InChI: InChI=1S/C25H19F2N5O2/c1-3-22(17-9-14-5-4-8-28-20(14)11-19(17)27)32-13-30-23-24(32)31-21(12-29-23)15-6-7-16(18(26)10-15)25(33)34-2/h4-13,22H,3H2,1-2H3
Standard InChI Key: XGGHCYWXHWHLSK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.9347 -7.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -8.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6416 -9.0165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6399 -7.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3485 -7.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3533 -8.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1333 -8.8515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6107 -8.1864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1256 -7.5270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3903 -9.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8471 -10.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1907 -9.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4425 -10.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2419 -10.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7264 -9.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5253 -9.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7831 -10.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5852 -10.2883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1304 -9.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8679 -8.8939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0663 -8.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1041 -11.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2275 -9.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5198 -8.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8123 -9.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8112 -9.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5235 -10.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2282 -9.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1037 -10.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3957 -9.8312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1041 -11.0566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3953 -9.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5258 -11.0566 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.8972 -11.1769 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
7 10 1 0
10 11 1 0
10 12 1 0
12 13 2 0
13 14 1 0
14 17 2 0
16 15 2 0
15 12 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
11 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
2 23 1 0
26 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
27 33 1 0
13 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.46Molecular Weight (Monoisotopic): 459.1507AlogP: 5.11#Rotatable Bonds: 5Polar Surface Area: 82.79Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.04CX LogP: 4.88CX LogD: 4.88Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.24
References 1. Zhao F, Zhang J, Zhang L, Hao Y, Shi C, Xia G, Yu J, Liu Y.. (2016) Discovery and optimization of a series of imidazo[4,5-b]pyrazine derivatives as highly potent and exquisitely selective inhibitors of the mesenchymal-epithelial transition factor (c-Met) protein kinase., 24 (18): [PMID:27448775 ] [10.1016/j.bmc.2016.07.019 ]