5,7-Difluoro-6-(1-(6-(naphthalen-1-yl)-1H-imidazo[4,5-b]pyrazin-1-yl)ethyl)quinoline

ID: ALA4524495

PubChem CID: 86566598

Max Phase: Preclinical

Molecular Formula: C26H17F2N5

Molecular Weight: 437.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(c1c(F)cc2ncccc2c1F)n1cnc2ncc(-c3cccc4ccccc34)nc21

Standard InChI:  InChI=1S/C26H17F2N5/c1-15(23-20(27)12-21-19(24(23)28)10-5-11-29-21)33-14-31-25-26(33)32-22(13-30-25)18-9-4-7-16-6-2-3-8-17(16)18/h2-15H,1H3

Standard InChI Key:  PKIMMBCWUXBFNC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   31.8271  -13.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8259  -14.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5409  -14.4709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5390  -12.8178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2545  -13.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2593  -14.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0469  -14.3044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5289  -13.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0391  -12.9671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3064  -15.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7579  -15.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1145  -15.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3687  -16.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1760  -16.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6554  -14.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4620  -14.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7223  -15.5883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5321  -15.7550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0826  -15.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8176  -14.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0082  -14.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1130  -14.4703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3916  -13.8564    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.8182  -16.6522    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.3982  -14.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6840  -14.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6847  -15.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3995  -15.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1136  -15.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9692  -14.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9686  -13.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6827  -12.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3975  -13.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 12  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  2 22  1  0
 15 23  1  0
 13 24  1  0
 22 25  2  0
 22 29  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 25 33  1  0
 25 26  1  0
 26 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
M  END

Associated Targets(Human)

MET Tclin Hepatocyte growth factor receptor (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H1993 (343 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.45Molecular Weight (Monoisotopic): 437.1452AlogP: 6.08#Rotatable Bonds: 3
Polar Surface Area: 56.49Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.76CX LogP: 5.35CX LogD: 5.35
Aromatic Rings: 6Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.96

References

1. Zhao F, Zhang J, Zhang L, Hao Y, Shi C, Xia G, Yu J, Liu Y..  (2016)  Discovery and optimization of a series of imidazo[4,5-b]pyrazine derivatives as highly potent and exquisitely selective inhibitors of the mesenchymal-epithelial transition factor (c-Met) protein kinase.,  24  (18): [PMID:27448775] [10.1016/j.bmc.2016.07.019]

Source